| Catalog Number |
ACM13463417-2 |
| CAS |
13463-41-7 |
| Structure |
 |
| Description |
Pyrithione zinc, also commonly known as zinc pyrithione, has antibacterial, antimicrobial, and antifungal properties that can help treat seborrheic dermatitis (also called dandruff), scalp psoriasis, and acne. |
| Synonyms |
ZPT |
| IUPAC Name |
Zinc;1-oxidopyridin-1-ium-2-thiolate |
| Molecular Weight |
317.40 |
| Molecular Formula |
C10H8N2O2S2Zn |
| Canonical SMILES |
C1=CC=[N+](C(=C1)[S-])[O-].C1=CC=[N+](C(=C1)[S-])[O-].[Zn+2] |
| InChI |
InChI=1S/2C5H5NOS.Zn/c2*7-6-4-2-1-3-5(6)8;/h2*1-4,8H;/q;+2/p-2 |
| InChI Key |
OTPSWLRZXRHDNX-UHFFFAOYSA-L |
| Melting Point |
240 ℃ |
| Purity |
98% |
| Density |
1.782 g/cm3 |
| Solubility |
insoluble (<0.1 g/100 mL at 21 ºC) |
| Appearance |
White to slight yellow powder or white suspension |
| Application |
ZPT-50 is the most important antidandruf agent in the world, which used for more than 30 years in shampoo. ZPT-50 shows excellent inhibiting effect on pytyrosporum ovale that causes dandruff.
ZPT has broad spectrum bactericide and marine antifouling material, and is well used for cosmetic, shampoo, skins medicine, adhesive and coating painting and so on. |
| Storage |
Content is unchanged in two years. |
| Complexity |
183 |
| Covalently-Bonded Unit Count |
3 |
| Defined Atom Stereocenter Count |
0 |
| EC Number |
236-671-3 |
| Exact Mass |
315.931862 |
| Formal Charge |
0 |
| Heavy Atom Count |
17 |
| Hydrogen Bond Acceptor Count |
4 |
| Hydrogen Bond Donor Count |
0 |
| Monoisotopic Mass |
315.931862 |
| Properties |
Low solubility in water |
| Rotatable Bond Count |
2 |
| Topological Polar Surface Area |
52.9 Ų |
