Zinc protoporphyrin

Catalog Number	ACM15442645-2
CAS	15442-64-5
Structure
Synonyms	Protoporphyrin IX zinc(II)
Molecular Weight	626
Molecular Formula	C34H32N4O4Zn
Canonical SMILES	CC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C(=C3CCC(=O)O)C)CCC(=O)O.[Zn+2]
InChI	InChI=1S/C34H34N4O4.Zn/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2
InChI Key	FUTVBRXUIKZACV-UHFFFAOYSA-L
Purity	99%
Appearance	Crystalline
Complexity	1580
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	624.171497
Heavy Atom Count	43
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	2
Monoisotopic Mass	624.171497
Rotatable Bond Count	8
Topological Polar Surface Area	101 Ų

Q&A

What is the CAS number for Zinc protoporphyrin?

The CAS number for Zinc protoporphyrin is 553-12-8.

What is the molecular weight of Zinc protoporphyrin?

The molecular weight of Zinc protoporphyrin is 562.66.

What are the product categories that Zinc protoporphyrin belongs to?

Zinc protoporphyrin belongs to the categories of Inhibitors; Natural Porphyrins and Derivatives; and Porphyrins.

What is the color of Zinc protoporphyrin?

Zinc protoporphyrin is purple in color.

What is the water solubility of Zinc protoporphyrin at 25°C?

The water solubility of Zinc protoporphyrin at 25°C is 106.9mg/L.

What is the melting point of Zinc protoporphyrin with acetone as the solvent?

The melting point of Zinc protoporphyrin with acetone as the solvent is greater than 300°C.

What are the hazard codes associated with Zinc protoporphyrin?

The hazard code associated with Zinc protoporphyrin is Xi.

What are the safety statements in relation to Zinc protoporphyrin?

The safety statements associated with Zinc protoporphyrin are 26-36.

What is the uses of Zinc protoporphyrin?

Zinc protoporphyrin is used as a hepatoprotectant.

What enzyme inhibitor properties does Zinc protoporphyrin possess?

Zinc protoporphyrin is an enzyme inhibitor for various enzymes including aminolevulinate aminotransferase, heme oxygenase, and nitric-oxide synthase.