Vinyldiphenylphosphine

Catalog Number	ACM2155966-1
CAS	2155-96-6
Structure
Synonyms	Diphenyl(Vinyl)Phosphine
IUPAC Name	ethenyl(diphenyl)phosphane
Molecular Weight	212.23
Molecular Formula	C14H13P
InChI	AJVBXLXLODZUME-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H13P/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2-12H,1H2
Boiling Point	104 °C at 0.25 mmHg (lit.)
Melting Point	70.5-71.5 °C
Flash Point	>110 °C
Purity	98%
Density	1.067 g/mL at 25 °C (lit.)
Appearance	Liquid
Isomeric SMILES	C=CP(C1=CC=CC=C1)C2=CC=CC=C2

Q&A

What is the CAS number for Vinyldiphenylphosphine?

CAS number for Vinyldiphenylphosphine is 2155-96-6.

What is the Canonical SMILES for Vinyldiphenylphosphine?

The Canonical SMILES for Vinyldiphenylphosphine is C=CP(C1=CC=CC=C1)C2=CC=CC=C2.

What is the Computed Properties Heavy Atom Count for Vinyldiphenylphosphine?

The Computed Properties Heavy Atom Count for Vinyldiphenylphosphine is 15.

Is Vinyldiphenylphosphine a hydrogen bond acceptor?

No, Vinyldiphenylphosphine has a Hydrogen Bond Acceptor Count of 0.

What is the XLogP3 value for Vinyldiphenylphosphine?

The XLogP3 value for Vinyldiphenylphosphine is 3.5.

What is the exact molecular weight of Vinyldiphenylphosphine?

The exact molecular weight of Vinyldiphenylphosphine is 212.23g/mol.

What is the InChIKey for Vinyldiphenylphosphine?

The InChIKey for Vinyldiphenylphosphine is AJVBXLXLODZUME-UHFFFAOYSA-N.

What are some depositor-supplied synonyms for Vinyldiphenylphosphine?

Some depositor-supplied synonyms for Vinyldiphenylphosphine are Diphenylvinylphosphine, Ethenyldiphenylphosphine, and Phosphine, ethenyldiphenyl-.

What is the molecular formula of Vinyldiphenylphosphine?

The molecular formula of Vinyldiphenylphosphine is C14H13P.

What is the name of Vinyldiphenylphosphine with the chemical structure shown?

The name of Vinyldiphenylphosphine with the chemical structure shown is Vinyldiphenylphosphine.