ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

Tris(pentafluorophenyl)phosphine

Catalog Number ACM1259354-2
CAS 1259-35-4
Structure Tris(pentafluorophenyl)phosphine
Synonyms Tris(2,3,4,5,6-pentafluorophenyl)phosphane; Phosphine, tris(pentafluorophenyl)-
IUPAC Name tris(2,3,4,5,6-pentafluorophenyl)phosphane
Molecular Weight 532.14
Molecular Formula C18F15P
InChI FQLSDFNKTNBQLC-UHFFFAOYSA-N
InChI Key InChI=1S/C18F15P/c19-1-4(22)10(28)16(11(29)5(1)23)34(17-12(30)6(24)2(20)7(25)13(17)31)18-14(32)8(26)3(21)9(27)15(18)33
Boiling Point 343.4±42.0 °C(Predicted)
Melting Point 108-110 °C(lit.)
Purity 98%+
Appearance Solid
Isomeric SMILES C1(=C(C(=C(C(=C1F)F)P(C2=C(C(=C(C(=C2F)F)F)F)F)C3=C(C(=C(C(=C3F)F)F)F)F)F)F)F
Q&A

What is the CAS number of Tris(pentafluorophenyl)phosphine?

The CAS number of Tris(pentafluorophenyl)phosphine is 1259-35-4.

What is the molecular formula of Tris(pentafluorophenyl)phosphine?

The molecular formula of Tris(pentafluorophenyl)phosphine is C18F15P.

What is the exact mass of Tris(pentafluorophenyl)phosphine?

The exact mass of Tris(pentafluorophenyl)phosphine is 531.9498094.

What is the IUPAC name of Tris(pentafluorophenyl)phosphine?

The IUPAC name of Tris(pentafluorophenyl)phosphine is tris(2,3,4,5,6-pentafluorophenyl)phosphane.

How many hydrogen bond acceptor counts does Tris(pentafluorophenyl)phosphine have?

Tris(pentafluorophenyl)phosphine has 15 hydrogen bond acceptor counts.

What is the Computed Properties XLogP3 value of Tris(pentafluorophenyl)phosphine?

The Computed Properties XLogP3 value of Tris(pentafluorophenyl)phosphine is 6.1.

What are some of the Depositor-Supplied Synonyms for Tris(pentafluorophenyl)phosphine?

Some Depositor-Supplied Synonyms for Tris(pentafluorophenyl)phosphine include Tris(perfluorophenyl)phosphine, Tris(2,3,4,5,6-pentafluorophenyl)phosphane, and Tris(2,3,4,5,6-pentafluorophenyl)phosphine.

What is the Monoisotopic Mass of Tris(pentafluorophenyl)phosphine?

The Monoisotopic Mass of Tris(pentafluorophenyl)phosphine is 531.9498094.

What is the UNII number for Tris(pentafluorophenyl)phosphine?

The UNII number for Tris(pentafluorophenyl)phosphine is R4P6L83YFZ.

What is the name of the InChIKey for Tris(pentafluorophenyl)phosphine?

The name of the InChIKey for Tris(pentafluorophenyl)phosphine is FQLSDFNKTNBQLC-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.