Tris(p-fluorophenyl)phosphine

Catalog Number	ACM18437780-1
CAS	18437-78-0
Structure
Synonyms	Tris(4-Fluorophenyl)Phosphine
IUPAC Name	tris(4-fluorophenyl)phosphane
Molecular Weight	316.26
Molecular Formula	C18H12F3P
InChI	GEPJPYNDFSOARB-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H12F3P/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H
Boiling Point	160 °C at 0.1 mmHg(lit.)
Melting Point	79-83 °C(lit.)
Purity	98%
Appearance	Solid
Isomeric SMILES	C1=CC(=CC=C1F)P(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F

Q&A

What is the Monoisotopic Mass of Tris(p-fluorophenyl)phosphine?

The Monoisotopic Mass of Tris(p-fluorophenyl)phosphine is 316.06287187

What is the Canonical SMILES representation of Tris(p-fluorophenyl)phosphine?

The Canonical SMILES representation of Tris(p-fluorophenyl)phosphine is C1=CC(=CC=C1F)P(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F

What is the CAS number for Tris(p-fluorophenyl)phosphine?

The CAS number for Tris(p-fluorophenyl)phosphine is 18437-78-0

How many Heavy Atoms are present in Tris(p-fluorophenyl)phosphine?

There are 22 Heavy Atoms present in Tris(p-fluorophenyl)phosphine

What is the XLogP3 value for Tris(p-fluorophenyl)phosphine?

The XLogP3 value for Tris(p-fluorophenyl)phosphine is 4.9

What is the Exact Mass of Tris(p-fluorophenyl)phosphine?

The Exact Mass of Tris(p-fluorophenyl)phosphine is 316.06287187

What is the IUPAC Name of Tris(p-fluorophenyl)phosphine?

The IUPAC Name of Tris(p-fluorophenyl)phosphine is tris(4-fluorophenyl)phosphane

How many Rotatable Bond Count does Tris(p-fluorophenyl)phosphine have?

Tris(p-fluorophenyl)phosphine has 3 Rotatable Bond Count

What is the Molecular Formula of Tris(p-fluorophenyl)phosphine?

The Molecular Formula of Tris(p-fluorophenyl)phosphine is C18H12F3P