Tris(3-methoxyphenyl)phosphine

Catalog Number	ACM29949846-1
CAS	29949-84-6
Structure
Synonyms	Tris(m-anisyl)phosphine; Tris(m-Methoxyphenyl)phosphine
IUPAC Name	tris(3-methoxyphenyl)phosphane
Molecular Weight	352.36
Molecular Formula	C21H21O3P
Canonical SMILES	COC1=CC(=CC=C1)P(C2=CC=CC(=C2)OC)C3=CC=CC(=C3)OC;
InChI	CCXTYQMZVYIQRP-UHFFFAOYSA-N
InChI Key	InChI=1S/C21H21O3P/c1-22-16-7-4-10-19(13-16)25(20-11-5-8-17(14-20)23-2)21-12-6-9-18(15-21)24-3/h4-15H,1-3H3
Boiling Point	476.3±40.0 °C(Predicted)
Melting Point	113-115 °C(lit.)
Purity	98%
Appearance	Solid
Application	suzuki reaction
Complexity	334
Covalently-Bonded Unit Count	1
Exact Mass	352.123g/mol
Heavy Atom Count	25
Isomeric SMILES	COC1=CC(=CC=C1)P(C2=CC=CC(=C2)OC)C3=CC=CC(=C3)OC
Monoisotopic Mass	352.123g/mol
Rotatable Bond Count	6
Topological Polar Surface Area	27.7A^2

Q&A

What is the molecular formula of Tris(3-methoxyphenyl)phosphine?

The molecular formula of Tris(3-methoxyphenyl)phosphine is C21H21O3P.

When was Tris(3-methoxyphenyl)phosphine first created?

Tris(3-methoxyphenyl)phosphine was first created on March 26, 2005.

What is the molecular weight of Tris(3-methoxyphenyl)phosphine?

The molecular weight of Tris(3-methoxyphenyl)phosphine is 352.4 g/mol.

What is the InChIKey of Tris(3-methoxyphenyl)phosphine?

The InChIKey of Tris(3-methoxyphenyl)phosphine is CCXTYQMZVYIQRP-UHFFFAOYSA-N.

How many hydrogen bond acceptors does Tris(3-methoxyphenyl)phosphine have?

Tris(3-methoxyphenyl)phosphine has 3 hydrogen bond acceptors.

What is the exact mass of Tris(3-methoxyphenyl)phosphine?

The exact mass of Tris(3-methoxyphenyl)phosphine is 352.12283153 g/mol.

How many rotatable bonds does Tris(3-methoxyphenyl)phosphine have?

Tris(3-methoxyphenyl)phosphine has 6 rotatable bonds.

Is Tris(3-methoxyphenyl)phosphine a canonical compound?

Yes, Tris(3-methoxyphenyl)phosphine is a canonical compound.

What is the topological polar surface area of Tris(3-methoxyphenyl)phosphine?

The topological polar surface area of Tris(3-methoxyphenyl)phosphine is 27.7 Ų.

How many covalently-bonded units does Tris(3-methoxyphenyl)phosphine have?

Tris(3-methoxyphenyl)phosphine has 1 covalently-bonded unit.