What is the exact Molecular Weight of Tris(4-chlorophenyl)phosphine?
The exact Molecular Weight of Tris(4-chlorophenyl)phosphine is 365.6g/mol.
What is the Canonical SMILES of Tris(4-chlorophenyl)phosphine?
The Canonical SMILES of Tris(4-chlorophenyl)phosphine is C1=CC(=CC=C1P(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl).
How many Heavy Atoms are present in Tris(4-chlorophenyl)phosphine?
Tris(4-chlorophenyl)phosphine contains 22 Heavy Atoms.
What is the IUPAC Name of Tris(4-chlorophenyl)phosphine?
The IUPAC Name of Tris(4-chlorophenyl)phosphine is tris(4-chlorophenyl)phosphane.
Is Tris(4-chlorophenyl)phosphine a Hydrogen Bond Acceptor?
Tris(4-chlorophenyl)phosphine does not have any Hydrogen Bond Acceptor Count.
What is the Molecular Formula of Tris(4-chlorophenyl)phosphine?
The Molecular Formula of Tris(4-chlorophenyl)phosphine is C18H12Cl3P.
What is the European Community (EC) Number for Tris(4-chlorophenyl)phosphine?
The European Community (EC) Number for Tris(4-chlorophenyl)phosphine is 214-596-7.
What is the CAS number for Tris(4-chlorophenyl)phosphine?
The CAS number for Tris(4-chlorophenyl)phosphine is 1159-54-2.
How many Rotatable Bonds are present in Tris(4-chlorophenyl)phosphine?
Tris(4-chlorophenyl)phosphine has 3 Rotatable Bonds.