Tris(4-bromophenyl)phosphane

Catalog Number	ACM29949813-1
CAS	29949-81-3
Structure
Synonyms	Phosphine, tris(4-bromophenyl)-; Tris(4-Bromophenyl)Phosphine
IUPAC Name	tris(4-bromophenyl)phosphane
Molecular Weight	498.97
Molecular Formula	C18H12Br3P
InChI	GMRACXJRJFIBHU-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H12Br3P/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H
Boiling Point	466.7±40.0 °C(Predicted)
Purity	95%
Appearance	White solid
Isomeric SMILES	C1=CC(=CC=C1P(C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br)Br

Q&A

What is the IUPAC name of Tris(4-bromophenyl)phosphane?

The IUPAC name of Tris(4-bromophenyl)phosphane is tris(4-bromophenyl)phosphane.

How many heavy atoms are present in the Tris(4-bromophenyl)phosphane molecule?

There are 22 heavy atoms in the Tris(4-bromophenyl)phosphane molecule.

What is the molar mass of Tris(4-bromophenyl)phosphane?

The molar mass of Tris(4-bromophenyl)phosphane is 499.0g/mol.

What is the exact mass of Tris(4-bromophenyl)phosphane?

The exact mass of Tris(4-bromophenyl)phosphane is 497.82063.

What is the Canonical SMILES representation of Tris(4-bromophenyl)phosphane?

The Canonical SMILES for Tris(4-bromophenyl)phosphane is C1=CC(=CC=C1P(C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br)Br.

Does Tris(4-bromophenyl)phosphane contain any hydrogen bond acceptor or donor sites?

Tris(4-bromophenyl)phosphane does not contain any hydrogen bond acceptor or donor sites.

What is the InChI key for Tris(4-bromophenyl)phosphane?

The InChI key for Tris(4-bromophenyl)phosphane is GMRACXJRJFIBHU-UHFFFAOYSA-N.

Are there any stereocenters present in the molecular structure of Tris(4-bromophenyl)phosphane?

There are no defined atom or bond stereocenters present in the molecular structure of Tris(4-bromophenyl)phosphane.

How many rotatable bonds are there in the Tris(4-bromophenyl)phosphane molecule?

There are 3 rotatable bonds in the Tris(4-bromophenyl)phosphane molecule.