Tris(4-morpholino)phosphine

Catalog Number	ACM5815612-1
CAS	5815-61-2
Structure
Synonyms	Phosphoric trimorpholide; Tris(morpholino)phosphine; Trimorpholin-4-ylphosphane
IUPAC Name	trimorpholin-4-ylphosphane
Molecular Weight	298.31
Molecular Formula	C12H24N3O3P
Canonical SMILES	C1COCCN1P(N2CCOCC2)N3CCOCC3
InChI	CYABZYIVQJYRDT-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H24N3O3P/c1-7-16-8-2-13(1)19(14-3-9-17-10-4-14)15-5-11-18-12-6-15/h1-12H2
Boiling Point	401.8±45.0 °C(Predicted)
Melting Point	157 °C
Purity	98%
Density	1.34g/cm³
Appearance	Solid
Exact Mass	289.15600
Isomeric SMILES	C1COCCN1P(N2CCOCC2)N3CCOCC3
pKa	8.99±0.20(Predicted)

Q&A

What is the IUPAC name of the compound with the CAS number 4441-12-7?

The IUPAC name of the compound with the CAS number 4441-12-7 is 4-dimorpholin-4-ylphosphorylmorpholine.

What is the molecular formula of the compound with the CAS number 4441-12-7?

The molecular formula of the compound with the CAS number 4441-12-7 is C12H24N3O4P.

What is the exact mass of the compound with the CAS number 4441-12-7?

The exact mass of the compound with the CAS number 4441-12-7 is 305.15044325.

How many hydrogen bond acceptors does the compound with the CAS number 4441-12-7 have?

The compound with the CAS number 4441-12-7 has 7 hydrogen bond acceptors.

What is the Canonical SMILES representation of the compound with the CAS number 4441-12-7?

The Canonical SMILES representation of the compound with the CAS number 4441-12-7 is C1COCCN1P(=O)(N2CCOCC2)N3CCOCC3.

What is another name for the compound with the CAS number 4441-12-7?

Another name for the compound with the CAS number 4441-12-7 is Tri(4-morpholino)phosphine oxide.

What is the Computed Properties Heavy Atom Count of the compound with the CAS number 4441-12-7?

The Computed Properties Heavy Atom Count of the compound with the CAS number 4441-12-7 is 20.

What is the InChIKey of the compound with the CAS number 4441-12-7?

The InChIKey of the compound with the CAS number 4441-12-7 is WXMQHPKQCPCDQO-UHFFFAOYSA-N.

What is the Depositor-Supplied Synonym that contains the compound "Tris"?

The Depositor-Supplied Synonym that contains the compound "Tris" is Tris-(morpholino)-phosphine oxide.

What is the UNII number of the compound with the CAS number 4441-12-7?

The UNII number of the compound with the CAS number 4441-12-7 is K6FWD4S4ZD.