ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Triphenylphosphine sulfide

Catalog Number ACM3878453-1
CAS 3878-45-3
Structure {[CurrentData.Name]}
Synonyms Triphenylphosphino-1-Thione
IUPAC Name triphenyl(sulfanylidene)-lambda5-phosphane
Molecular Weight 294.35
Molecular Formula C18H15PS
InChI VYNGFCUGSYEOOZ-UHFFFAOYSA-N
InChI Key InChI=1S/C18H15PS/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
Boiling Point 428.7±28.0 °C(Predicted)
Melting Point 161-163 °C(lit.)
Flash Point 213.1ºC
Purity 99%
Density 1.2 g/cm3
Appearance Solid
Exact Mass 294.06300
Isomeric SMILES C1=CC=C(C=C1)P(=S)(C2=CC=CC=C2)C3=CC=CC=C3
Packing Group III
Q&A

What is the CAS number for Triphenylphosphine sulfide?

The CAS number for Triphenylphosphine sulfide is 3878-45-3.

What is the molecular formula of Triphenylphosphine sulfide?

The molecular formula of Triphenylphosphine sulfide is C18H15PS.

How many heavy atoms are present in the molecule of Triphenylphosphine sulfide?

There are 20 heavy atoms present in the molecule of Triphenylphosphine sulfide.

What is the Canonical SMILES representation of Triphenylphosphine sulfide?

The Canonical SMILES representation of Triphenylphosphine sulfide is C1=CC=C(C=C1)P(=S)(C2=CC=CC=C2)C3=CC=CC=C3.

What is the IUPAC name of Triphenylphosphine sulfide?

The IUPAC name of Triphenylphosphine sulfide is triphenyl(sulfanylidene)-λ5-phosphane.

What is the exact mass of Triphenylphosphine sulfide?

The exact mass of Triphenylphosphine sulfide is 294.06320865.

How many rotatable bonds are present in the structure of Triphenylphosphine sulfide?

There are 3 rotatable bonds present in the structure of Triphenylphosphine sulfide.

What is the topological polar surface area of Triphenylphosphine sulfide?

The topological polar surface area of Triphenylphosphine sulfide is 32.1.

What is the InChIKey for Triphenylphosphine sulfide?

The InChIKey for Triphenylphosphine sulfide is VYNGFCUGSYEOOZ-UHFFFAOYSA-N.

What is the molecular weight of Triphenylphosphine sulfide?

The molecular weight of Triphenylphosphine sulfide is 294.4g/mol.

Please kindly note that our products and services are for research use only.