Triphenylphosphine sulfide

Catalog Number	ACM3878453-1
CAS	3878-45-3
Structure
Synonyms	Triphenylphosphino-1-Thione
IUPAC Name	triphenyl(sulfanylidene)-lambda5-phosphane
Molecular Weight	294.35
Molecular Formula	C18H15PS
InChI	VYNGFCUGSYEOOZ-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H15PS/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
Boiling Point	428.7±28.0 °C(Predicted)
Melting Point	161-163 °C(lit.)
Flash Point	213.1ºC
Purity	99%
Density	1.2 g/cm3
Appearance	Solid
Exact Mass	294.06300
Isomeric SMILES	C1=CC=C(C=C1)P(=S)(C2=CC=CC=C2)C3=CC=CC=C3

Q&A

What is the CAS number for Triphenylphosphine sulfide?

The CAS number for Triphenylphosphine sulfide is 3878-45-3.

What is the molecular formula of Triphenylphosphine sulfide?

The molecular formula of Triphenylphosphine sulfide is C18H15PS.

How many heavy atoms are present in the molecule of Triphenylphosphine sulfide?

There are 20 heavy atoms present in the molecule of Triphenylphosphine sulfide.

What is the Canonical SMILES representation of Triphenylphosphine sulfide?

The Canonical SMILES representation of Triphenylphosphine sulfide is C1=CC=C(C=C1)P(=S)(C2=CC=CC=C2)C3=CC=CC=C3.

What is the IUPAC name of Triphenylphosphine sulfide?

The IUPAC name of Triphenylphosphine sulfide is triphenyl(sulfanylidene)-λ5-phosphane.

What is the exact mass of Triphenylphosphine sulfide?

The exact mass of Triphenylphosphine sulfide is 294.06320865.

How many rotatable bonds are present in the structure of Triphenylphosphine sulfide?

There are 3 rotatable bonds present in the structure of Triphenylphosphine sulfide.

What is the topological polar surface area of Triphenylphosphine sulfide?

The topological polar surface area of Triphenylphosphine sulfide is 32.1.

What is the InChIKey for Triphenylphosphine sulfide?

The InChIKey for Triphenylphosphine sulfide is VYNGFCUGSYEOOZ-UHFFFAOYSA-N.

What is the molecular weight of Triphenylphosphine sulfide?

The molecular weight of Triphenylphosphine sulfide is 294.4g/mol.