ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

Triphenylphosphine-1,4-Benzoquinone Adduct

Catalog Number ACM5405630-1
CAS 5405-63-0
Synonyms 4-Hydroxy-2-(triphenylphosphonium)phenolate
IUPAC Name (2,5-dihydroxyphenyl)-triphenylphosphanium
Molecular Weight 371.39
Molecular Formula C24H20O2P+
InChI YCXVHURLDBUOMW-UHFFFAOYSA-O
InChI Key InChI=1S/C24H19O2P/c25-19-16-17-23(26)24(18-19)27(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-18H,(H-,25,26)/p+1
Purity 98%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=C(C=CC(=C4)O)O
Q&A

What is the CAS number for Triphenylphosphine-1,4-Benzoquinone Adduct?

The CAS numbers for Triphenylphosphine-1,4-Benzoquinone Adduct are 50651-56-4 and 5405-63-0.

What is the molecular weight of Triphenylphosphine-1,4-Benzoquinone Adduct?

The molecular weight of Triphenylphosphine-1,4-Benzoquinone Adduct is 370.4 g/mol.

What is the molecular formula of Triphenylphosphine-1,4-Benzoquinone Adduct?

The molecular formula of Triphenylphosphine-1,4-Benzoquinone Adduct is C24H19O2P.

How many hydrogen bond acceptors does Triphenylphosphine-1,4-Benzoquinone Adduct have?

Triphenylphosphine-1,4-Benzoquinone Adduct has 2 hydrogen bond acceptors.

Are there any defined atom stereocenters in the structure of Triphenylphosphine-1,4-Benzoquinone Adduct?

No, there are no defined atom stereocenters in the structure of Triphenylphosphine-1,4-Benzoquinone Adduct.

What is the Canonical SMILES representation of Triphenylphosphine-1,4-Benzoquinone Adduct?

The Canonical SMILES representation of Triphenylphosphine-1,4-Benzoquinone Adduct is C1=CC=C(C=C1)P(=C2C=C(C=CC2=O)O)(C3=CC=CC=C3)C4=CC=CC=C4.

What is the IUPAC name of Triphenylphosphine-1,4-Benzoquinone Adduct?

The IUPAC name of Triphenylphosphine-1,4-Benzoquinone Adduct is 4-hydroxy-6-(triphenyl-λ5-phosphanylidene)cyclohexa-2,4-dien-1-one.

Is Triphenylphosphine-1,4-Benzoquinone Adduct listed under any depositor-supplied synonyms?

Yes, Triphenylphosphine-1,4-Benzoquinone Adduct is listed under various depositor-supplied synonyms such as 4-hydroxy-6-(triphenylphosphoranylidene)cyclohexa-2,4-dienone and NSC-5196.

What is the XLogP3 value of Triphenylphosphine-1,4-Benzoquinone Adduct?

The XLogP3 value of Triphenylphosphine-1,4-Benzoquinone Adduct is 3.7.

What is the exact mass of Triphenylphosphine-1,4-Benzoquinone Adduct?

The exact mass of Triphenylphosphine-1,4-Benzoquinone Adduct is 370.11226684.

Please kindly note that our products and services are for research use only.