ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Trioctyl(phenyl)phosphonium bromide

Catalog Number ACM90144915
CAS 90144-91-5
IUPAC Name trioctyl(phenyl)phosphanium;bromide
Molecular Weight 527.64
Molecular Formula C30H56BrP
InChI NMMXEEYKNQSNDG-UHFFFAOYSA-M
InChI Key InChI=1S/C30H56P.BrH/c1-4-7-10-13-16-22-27-31(30-25-20-19-21-26-30,28-23-17-14-11-8-5-2)29-24-18-15-12-9-6-3;/h19-21,25-26H,4-18,22-24,27-29H2,1-3H3;1H/q+1;/p-1
Purity 98%
Isomeric SMILES CCCCCCCC[P+](CCCCCCCC)(CCCCCCCC)C1=CC=CC=C1.[Br-]
Q&A

What is the CAS number of Trioctyl(phenyl)phosphonium bromide?

The CAS number of Trioctyl(phenyl)phosphonium bromide is 90144-91-5.

What is the molecular formula of Trioctyl(phenyl)phosphonium bromide?

The molecular formula of Trioctyl(phenyl)phosphonium bromide is C30H56BrP.

What is the molecular weight of Trioctyl(phenyl)phosphonium bromide?

The molecular weight of Trioctyl(phenyl)phosphonium bromide is 527.6g/mol.

What is the canonical SMILES of Trioctyl(phenyl)phosphonium bromide?

The canonical SMILES of Trioctyl(phenyl)phosphonium bromide is CCCCCCCC[P+](CCCCCCCC)(CCCCCCCC)C1=CC=CC=C1.[Br-]

How many heavy atoms are present in Trioctyl(phenyl)phosphonium bromide?

There are 32 heavy atoms present in Trioctyl(phenyl)phosphonium bromide.

What is the IUPAC name of Trioctyl(phenyl)phosphonium bromide?

The IUPAC name of Trioctyl(phenyl)phosphonium bromide is trioctyl(phenyl)phosphanium;bromide.

What is the exact mass of Trioctyl(phenyl)phosphonium bromide?

The exact mass of Trioctyl(phenyl)phosphonium bromide is 526.33030.

How many rotatable bonds are present in Trioctyl(phenyl)phosphonium bromide?

There are 22 rotatable bonds present in Trioctyl(phenyl)phosphonium bromide.

What is the InChIKey of Trioctyl(phenyl)phosphonium bromide?

The InChIKey of Trioctyl(phenyl)phosphonium bromide is NMMXEEYKNQSNDG-UHFFFAOYSA-M.

How many covalently-bonded units are present in Trioctyl(phenyl)phosphonium bromide?

There are 2 covalently-bonded units present in Trioctyl(phenyl)phosphonium bromide.

Please kindly note that our products and services are for research use only.