What is the IUPAC name of Trimethyl 3,3',3''-phosphinetriyltripropanoate?
The IUPAC name of Trimethyl 3,3',3''-phosphinetriyltripropanoate is methyl 3-bis(3-methoxy-3-oxopropyl)phosphanylpropanoate.
What is the molecular formula of Trimethyl 3,3',3''-phosphinetriyltripropanoate?
The molecular formula of Trimethyl 3,3',3''-phosphinetriyltripropanoate is C12H21O6P.
What is the CAS number of Trimethyl 3,3',3''-phosphinetriyltripropanoate?
The CAS number of Trimethyl 3,3',3''-phosphinetriyltripropanoate is 29269-17-8.
What is the InChIKey of Trimethyl 3,3',3''-phosphinetriyltripropanoate?
The InChIKey of Trimethyl 3,3',3''-phosphinetriyltripropanoate is GCGYESORUFVNSP-UHFFFAOYSA-N.
How many heavy atoms are present in Trimethyl 3,3',3''-phosphinetriyltripropanoate?
There are 19 heavy atoms present in Trimethyl 3,3',3''-phosphinetriyltripropanoate.
What is the Canonical SMILES representation of Trimethyl 3,3',3''-phosphinetriyltripropanoate?
The Canonical SMILES representation of Trimethyl 3,3',3''-phosphinetriyltripropanoate is COC(=O)CCP(CCC(=O)OC)CCC(=O)OC.
What is the molecular weight of Trimethyl 3,3',3''-phosphinetriyltripropanoate?
The molecular weight of Trimethyl 3,3',3''-phosphinetriyltripropanoate is 292.26g/mol.
How many hydrogen bond acceptor counts does Trimethyl 3,3',3''-phosphinetriyltripropanoate have?
The compound has 6 hydrogen bond acceptor counts.
What is the Monoisotopic Mass of Trimethyl 3,3',3''-phosphinetriyltripropanoate?
The Monoisotopic Mass of Trimethyl 3,3',3''-phosphinetriyltripropanoate is 292.10757538.