ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Trimethyl 3,3',3''-phosphinetriyltripropanoate

Catalog Number ACM29269178
CAS 29269-17-8
Structure {[CurrentData.Name]}
Synonyms Methyl 3-bis(3-methoxy-3-oxopropyl)phosphanylpropanoate
IUPAC Name methyl 3-bis(3-methoxy-3-oxopropyl)phosphanylpropanoate
Molecular Weight 292.27
Molecular Formula C12H21O6P
InChI GCGYESORUFVNSP-UHFFFAOYSA-N
InChI Key InChI=1S/C12H21O6P/c1-16-10(13)4-7-19(8-5-11(14)17-2)9-6-12(15)18-3/h4-9H2,1-3H3
Boiling Point 365.4±37.0 °C(Predicted)
Purity 95%
Isomeric SMILES COC(=O)CCP(CCC(=O)OC)CCC(=O)OC
Q&A

What is the IUPAC name of Trimethyl 3,3',3''-phosphinetriyltripropanoate?

The IUPAC name of Trimethyl 3,3',3''-phosphinetriyltripropanoate is methyl 3-bis(3-methoxy-3-oxopropyl)phosphanylpropanoate.

What is the molecular formula of Trimethyl 3,3',3''-phosphinetriyltripropanoate?

The molecular formula of Trimethyl 3,3',3''-phosphinetriyltripropanoate is C12H21O6P.

What is the CAS number of Trimethyl 3,3',3''-phosphinetriyltripropanoate?

The CAS number of Trimethyl 3,3',3''-phosphinetriyltripropanoate is 29269-17-8.

What is the InChIKey of Trimethyl 3,3',3''-phosphinetriyltripropanoate?

The InChIKey of Trimethyl 3,3',3''-phosphinetriyltripropanoate is GCGYESORUFVNSP-UHFFFAOYSA-N.

How many heavy atoms are present in Trimethyl 3,3',3''-phosphinetriyltripropanoate?

There are 19 heavy atoms present in Trimethyl 3,3',3''-phosphinetriyltripropanoate.

What is the Canonical SMILES representation of Trimethyl 3,3',3''-phosphinetriyltripropanoate?

The Canonical SMILES representation of Trimethyl 3,3',3''-phosphinetriyltripropanoate is COC(=O)CCP(CCC(=O)OC)CCC(=O)OC.

What is the molecular weight of Trimethyl 3,3',3''-phosphinetriyltripropanoate?

The molecular weight of Trimethyl 3,3',3''-phosphinetriyltripropanoate is 292.26g/mol.

How many hydrogen bond acceptor counts does Trimethyl 3,3',3''-phosphinetriyltripropanoate have?

The compound has 6 hydrogen bond acceptor counts.

What is the Monoisotopic Mass of Trimethyl 3,3',3''-phosphinetriyltripropanoate?

The Monoisotopic Mass of Trimethyl 3,3',3''-phosphinetriyltripropanoate is 292.10757538.

Please kindly note that our products and services are for research use only.