ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Trihexylphosphine hydrochloride

Catalog Number ACM1430948109
CAS 1430948-10-9
IUPAC Name trihexylphosphane;hydrochloride
Molecular Weight 322.94
Molecular Formula C18H40ClP
InChI SBTVQXOAJONPIW-UHFFFAOYSA-N
InChI Key InChI=1S/C18H39P.ClH/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3;/h4-18H2,1-3H3;1H
Purity 98%
Isomeric SMILES CCCCCCP(CCCCCC)CCCCCC.Cl
Q&A

What is the exact mass of Trihexylphosphine hydrochloride?

The exact mass of Trihexylphosphine hydrochloride is 322.2556160.

How many heavy atoms are present in the molecular formula of Trihexylphosphine hydrochloride?

There are 20 heavy atoms present in the molecular formula of Trihexylphosphine hydrochloride.

What is the IUPAC name of Trihexylphosphine hydrochloride?

The IUPAC name of Trihexylphosphine hydrochloride is trihexylphosphane;hydrochloride.

How many rotatable bonds are present in Trihexylphosphine hydrochloride?

There are 15 rotatable bonds present in Trihexylphosphine hydrochloride.

What is the molecular weight of Trihexylphosphine hydrochloride?

The molecular weight of Trihexylphosphine hydrochloride is 322.9g/mol.

What is the Canonical SMILES notation for Trihexylphosphine hydrochloride?

The Canonical SMILES notation for Trihexylphosphine hydrochloride is CCCCCCP(CCCCCC)CCCCCC.Cl.

How many covalently-bonded units are present in the computed properties of Trihexylphosphine hydrochloride?

There are 2 covalently-bonded units present in the computed properties of Trihexylphosphine hydrochloride.

How many hydrogen bond donors are present in Trihexylphosphine hydrochloride?

There is 1 hydrogen bond donor present in Trihexylphosphine hydrochloride.

What is the topological polar surface area of Trihexylphosphine hydrochloride?

The topological polar surface area of Trihexylphosphine hydrochloride is 0.

What is the InChIKey code for Trihexylphosphine hydrochloride?

The InChIKey code for Trihexylphosphine hydrochloride is SBTVQXOAJONPIW-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.