Tricyclohexylphosphonium tetrafluoroborate

Catalog Number	ACM58656045-1
CAS	58656-04-5
Structure
IUPAC Name	tricyclohexylphosphanium;tetrafluoroborate
Molecular Weight	368.24
Molecular Formula	C18H34BF4P
InChI	MYSMMEUXKHJYKH-UHFFFAOYSA-O
InChI Key	InChI=1S/C18H33P.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h16-18H,1-15H2;/q;-1/p+1
Melting Point	164 °C(lit.)
Purity	98%
Appearance	Solid
Isomeric SMILES	[B-](F)(F)(F)F.C1CCC(CC1)[PH+](C2CCCCC2)C3CCCCC3

Q&A

What is the CAS number of Tricyclohexylphosphonium tetrafluoroborate?

The CAS number of Tricyclohexylphosphonium tetrafluoroborate is 58656-04-5.

What is the molecular formula of Tricyclohexylphosphonium tetrafluoroborate?

The molecular formula of Tricyclohexylphosphonium tetrafluoroborate is C18H34BF4P.

What are the Computed Properties Defined Atom Stereocenter Count and Computed Properties Defined Bond Stereocenter Count for Tricyclohexylphosphonium tetrafluoroborate?

Both the Computed Properties Defined Atom Stereocenter Count and Computed Properties Defined Bond Stereocenter Count for Tricyclohexylphosphonium tetrafluoroborate are 0.

What is the Canonical SMILES representation of Tricyclohexylphosphonium tetrafluoroborate?

The Canonical SMILES representation of Tricyclohexylphosphonium tetrafluoroborate is [B-](F)(F)(F)F.C1CCC(CC1)[PH+](C2CCCCC2)C3CCCCC3.

What is the molecular weight of Tricyclohexylphosphonium tetrafluoroborate?

The molecular weight of Tricyclohexylphosphonium tetrafluoroborate is 368.2g/mol.

What is the IUPAC Name of Tricyclohexylphosphonium tetrafluoroborate?

The IUPAC Name of Tricyclohexylphosphonium tetrafluoroborate is tricyclohexylphosphanium;tetrafluoroborate.

How many hydrogen bond acceptors does Tricyclohexylphosphonium tetrafluoroborate have?

Tricyclohexylphosphonium tetrafluoroborate has 5 hydrogen bond acceptors.

What is the InChIKey of Tricyclohexylphosphonium tetrafluoroborate?

The InChIKey of Tricyclohexylphosphonium tetrafluoroborate is MYSMMEUXKHJYKH-UHFFFAOYSA-O.

What are some synonyms for Tricyclohexylphosphonium tetrafluoroborate?

Some synonyms for Tricyclohexylphosphonium tetrafluoroborate include Tricyclohexylphosphine tetrafluoroborate, SCHEMBL241581, and FT-0689086.

What is the European Community (EC) Number of Tricyclohexylphosphonium tetrafluoroborate?

The European Community (EC) Number of Tricyclohexylphosphonium tetrafluoroborate is 672-607-4.