Tri-tert-butylphosphine oxide

Catalog Number	ACM6866702
CAS	6866-70-2
Synonyms	2-Ditert-Butylphosphoryl-2-Methylpropane; PO(TBu)3
IUPAC Name	2-ditert-butylphosphoryl-2-methylpropane
Molecular Weight	218.32
Molecular Formula	C12H27OP
InChI	HDZUKJFHNQLAMW-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H27OP/c1-10(2,3)14(13,11(4,5)6)12(7,8)9/h1-9H3
Purity	98%
Isomeric SMILES	CC(C)(C)P(=O)(C(C)(C)C)C(C)(C)C

Q&A

What is the CAS number for Tri-tert-butylphosphine oxide?

The CAS number for Tri-tert-butylphosphine oxide is 6866-70-2.

What is the molecular formula of Tri-tert-butylphosphine oxide?

The molecular formula of Tri-tert-butylphosphine oxide is C12H27OP.

What is the IUPAC Name of Tri-tert-butylphosphine oxide?

The IUPAC Name of Tri-tert-butylphosphine oxide is 2-ditert-butylphosphoryl-2-methylpropane.

What is the exact mass of Tri-tert-butylphosphine oxide?

The exact mass of Tri-tert-butylphosphine oxide is 218.179952478.

How many heavy atoms are present in the Tri-tert-butylphosphine oxide molecule?

There are 14 heavy atoms present in the Tri-tert-butylphosphine oxide molecule.

How many rotatable bonds are there in the Tri-tert-butylphosphine oxide molecule?

There are 3 rotatable bonds in the Tri-tert-butylphosphine oxide molecule.

What is the topological polar surface area of Tri-tert-butylphosphine oxide?

The topological polar surface area of Tri-tert-butylphosphine oxide is 17.1.

What is the XLogP3 value of Tri-tert-butylphosphine oxide?

The XLogP3 value of Tri-tert-butylphosphine oxide is 2.3.

What is the InChIKey of Tri-tert-butylphosphine oxide?

The InChIKey of Tri-tert-butylphosphine oxide is HDZUKJFHNQLAMW-UHFFFAOYSA-N.

What are some other synonyms for Tri-tert-butylphosphine oxide?

Some other synonyms for Tri-tert-butylphosphine oxide include tri-t-butylphosphine oxide, PO(tBu)3, and Phosphine oxide, tris(1,1-dimethylethyl)-.