Tri-p-tolylphosphine

Catalog Number	ACM1038955-1
CAS	1038-95-5
Structure
Synonyms	Tri(4-Methylphenyl)Phosphine;Tri-Para-Tolylphosphine
IUPAC Name	tris(4-methylphenyl)phosphane
Molecular Weight	304.36
Molecular Formula	C21H21P
InChI	WXAZIUYTQHYBFW-UHFFFAOYSA-N
InChI Key	InChI=1S/C21H21P/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3
Boiling Point	399.8±41.0 °C(Predicted)
Melting Point	144-148 °C(lit.)
Purity	98%
Appearance	Solid
Isomeric SMILES	CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C

Q&A

What is the CAS number for Tri-p-tolylphosphine?

The CAS number for Tri-p-tolylphosphine is 1038-95-5.

How many heavy atoms are in the molecular formula of Tri-p-tolylphosphine?

There are 22 heavy atoms in the molecular formula of Tri-p-tolylphosphine.

What is the Canonical SMILES for Tri-p-tolylphosphine?

The Canonical SMILES for Tri-p-tolylphosphine is CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C.

How many rotatable bonds does Tri-p-tolylphosphine have?

Tri-p-tolylphosphine has 3 rotatable bonds.

What is the molecular weight of Tri-p-tolylphosphine?

The molecular weight of Tri-p-tolylphosphine is 304.4g/mol.

What is the IUPAC name for Tri-p-tolylphosphine?

The IUPAC name for Tri-p-tolylphosphine is tris(4-methylphenyl)phosphane.

How many hydrogen bond acceptors does Tri-p-tolylphosphine have?

Tri-p-tolylphosphine has 0 hydrogen bond acceptors.

What is the InChIKey for Tri-p-tolylphosphine?

The InChIKey for Tri-p-tolylphosphine is WXAZIUYTQHYBFW-UHFFFAOYSA-N.

Is Tri-p-tolylphosphine a donor or acceptor of hydrogen bonds?

Tri-p-tolylphosphine is neither a donor nor an acceptor of hydrogen bonds.

What is the exact mass of Tri-p-tolylphosphine?

The exact mass of Tri-p-tolylphosphine is 304.138087668.