ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Tri-N-Propylphosphine

Catalog Number ACM2234971-1
CAS 2234-97-1
Structure {[CurrentData.Name]}
Synonyms Tripropylphosphine
IUPAC Name tripropylphosphane
Molecular Weight 160.24
Molecular Formula C9H21P
InChI KCTAHLRCZMOTKM-UHFFFAOYSA-N
InChI Key InChI=1S/C9H21P/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3
Boiling Point 72-74 °C at 12 mmHg(lit.)
Flash Point 144 °F
Purity 99%
Density 0.801 g/mL at 25 °C(lit.)
Appearance Liquid
Isomeric SMILES CCCP(CCC)CCC
Q&A

What is the CAS number for Tri-N-Propylphosphine?

The CAS number for Tri-N-Propylphosphine is 1496-94-2.

What is the molecular formula of Tri-N-Propylphosphine?

The molecular formula of Tri-N-Propylphosphine is C9H21OP.

What is the canonical SMILES representation of Tri-N-Propylphosphine?

The canonical SMILES representation of Tri-N-Propylphosphine is CCCP(=O)(CCC)CCC.

How many hydrogen bond acceptor counts are there in Tri-N-Propylphosphine?

There is 1 hydrogen bond acceptor count in Tri-N-Propylphosphine.

What is the formal charge of Tri-N-Propylphosphine?

The formal charge of Tri-N-Propylphosphine is 0.

What is the IUPAC name of Tri-N-Propylphosphine?

The IUPAC name of Tri-N-Propylphosphine is 1-dipropylphosphorylpropane.

What is the molecular weight of Tri-N-Propylphosphine?

The molecular weight of Tri-N-Propylphosphine is 176.24 g/mol.

How many rotatable bond counts are there in Tri-N-Propylphosphine?

There are 6 rotatable bond counts in Tri-N-Propylphosphine.

What is the topological polar surface area of Tri-N-Propylphosphine?

The topological polar surface area of Tri-N-Propylphosphine is 17.1.

What is the InChI key for Tri-N-Propylphosphine?

The InChI key for Tri-N-Propylphosphine is SNZSAFILJOCMFM-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.