Tri-n-butylphosphonium tetrafluoroborate

Catalog Number	ACM113978919-2
CAS	113978-91-9
Structure
Synonyms	Tributylphosphine Tetrafluoroborate
IUPAC Name	tributylphosphanium;tetrafluoroborate
Molecular Weight	290.13
Molecular Formula	C12H28BF4P
InChI	NCHAZLRRIGGCER-UHFFFAOYSA-O
InChI Key	InChI=1S/C12H27P.BF4/c1-4-7-10-13(11-8-5-2)12-9-6-3;2-1(3,4)5/h4-12H2,1-3H3;/q;-1/p+1
Melting Point	50-53 °C(lit.)
Flash Point	>221 °F
Purity	98%
Appearance	Solid
Isomeric SMILES	[B-](F)(F)(F)F.CCCC[PH+](CCCC)CCCC

Q&A

What is the CAS number of Tri-n-butylphosphonium tetrafluoroborate?

The CAS number of Tri-n-butylphosphonium tetrafluoroborate is 113978-91-9.

What is the molecular formula of Tri-n-butylphosphonium tetrafluoroborate?

The molecular formula of Tri-n-butylphosphonium tetrafluoroborate is C12H28BF4P.

What is the molecular weight of Tri-n-butylphosphonium tetrafluoroborate?

The molecular weight of Tri-n-butylphosphonium tetrafluoroborate is 290.13g/mol.

How many defined atom stereocenters does Tri-n-butylphosphonium tetrafluoroborate have?

Tri-n-butylphosphonium tetrafluoroborate has 0 defined atom stereocenters.

What are some other names for Tri-n-butylphosphonium tetrafluoroborate?

Some other names for Tri-n-butylphosphonium tetrafluoroborate include Tributylphosphonium tetrafluoroborate, Tributylphosphine tetrafluoroborate, tBuP HBF4, and more.

What is the InChI key for Tri-n-butylphosphonium tetrafluoroborate?

The InChI key for Tri-n-butylphosphonium tetrafluoroborate is NCHAZLRRIGGCER-UHFFFAOYSA-O.

How many heavy atoms are present in Tri-n-butylphosphonium tetrafluoroborate?

There are 18 heavy atoms present in Tri-n-butylphosphonium tetrafluoroborate.

Does Tri-n-butylphosphonium tetrafluoroborate have any hydrogen bond donors?

No, Tri-n-butylphosphonium tetrafluoroborate does not have any hydrogen bond donors.

What is the topological polar surface area of Tri-n-butylphosphonium tetrafluoroborate?

The topological polar surface area of Tri-n-butylphosphonium tetrafluoroborate is 0.

What is the exact mass and monoisotopic mass of Tri-n-butylphosphonium tetrafluoroborate?

The exact mass and monoisotopic mass of Tri-n-butylphosphonium tetrafluoroborate are both 290.1957807.