ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Tri-i-butylphosphine

Catalog Number ACM4125251-1
CAS 4125-25-1
Structure {[CurrentData.Name]}
Synonyms Tris(2-Methylpropyl)Phosphane
IUPAC Name tris(2-methylpropyl)phosphane
Molecular Weight 202.32
Molecular Formula C12H27P
Canonical SMILES CC(C)CP(CC(C)C)CC(C)C
InChI DAGQYUCAQQEEJD-UHFFFAOYSA-N
InChI Key InChI=1S/C12H27P/c1-10(2)7-13(8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3
Boiling Point 126 °C at 50 mmHg(lit.)
Flash Point 50 °F
Purity 98%
Density 0.811 g/mL at 25 °C(lit.)
Appearance Liquid
EC Number 223-934-2
Exact Mass 202.18500
Isomeric SMILES CC(C)CP(CC(C)C)CC(C)C
Q&A

What is the CAS number for Tri-i-butylphosphine?

The CAS number for Tri-i-butylphosphine is 4125-25-1.

How many heavy atoms are present in the chemical structure of Tri-i-butylphosphine?

There are 13 heavy atoms present in the chemical structure of Tri-i-butylphosphine.

What is the formal charge of Tri-i-butylphosphine?

The formal charge of Tri-i-butylphosphine is 0.

How many rotatable bonds are present in the molecular structure of Tri-i-butylphosphine?

There are 6 rotatable bonds present in the molecular structure of Tri-i-butylphosphine.

What is the topological polar surface area of Tri-i-butylphosphine?

The topological polar surface area of Tri-i-butylphosphine is 0.

What is the IUPAC name of Tri-i-butylphosphine?

The IUPAC name of Tri-i-butylphosphine is tris(2-methylpropyl)phosphane.

What is the molecular formula of Tri-i-butylphosphine?

The molecular formula of Tri-i-butylphosphine is C12H27P.

What is the exact mass of Tri-i-butylphosphine?

The exact mass of Tri-i-butylphosphine is 202.185037859.

Provide three synonyms for Tri-i-butylphosphine.

Triisobutylphosphine, Tri-iso-butylphosphine, Tris(2-methylpropyl)phosphine

What is the InChIKey for Tri-i-butylphosphine?

The InChIKey for Tri-i-butylphosphine is DAGQYUCAQQEEJD-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.