What is the name of Tri-i-butyl(methyl)phosphonium tosylate?
The name of Tri-i-butyl(methyl)phosphonium tosylate is Tri-i-butyl(methyl)phosphonium tosylate.
What is the molecular formula of Tri-i-butyl(methyl)phosphonium tosylate?
The molecular formula is C30H57O3PS.
What is the molecular weight of Tri-i-butyl(methyl)phosphonium tosylate?
The molecular weight is 528.8g/mol.
What is the exact mass of Tri-i-butyl(methyl)phosphonium tosylate?
The exact mass is 528.37660385.
How many heavy atoms are present in Tri-i-butyl(methyl)phosphonium tosylate?
There are 35 heavy atoms present in Tri-i-butyl(methyl)phosphonium tosylate.
What is the Canonical SMILES representation of Tri-i-butyl(methyl)phosphonium tosylate?
The Canonical SMILES representation is CCCC[C@@H](C)[P+](CCCC(C)C)(CCCC(C)C)CCCC(C)C.OS(=O)(=O)[O-].
How many covalently-bonded units are present in Tri-i-butyl(methyl)phosphonium tosylate?
There are 2 covalently-bonded units present in Tri-i-butyl(methyl)phosphonium tosylate.
How many rotatable bonds are present in Tri-i-butyl(methyl)phosphonium tosylate?
There are 17 rotatable bonds present in Tri-i-butyl(methyl)phosphonium tosylate.
What is the InChIKey of Tri-i-butyl(methyl)phosphonium tosylate?
The InChIKey is WYBDAYBFOCKDRR-UHFFFAOYSA-M.
What is the IUPAC name of Tri-i-butyl(methyl)phosphonium tosylate?
The IUPAC name is 4-methylbenzenesulfonate;methyl-bis(2-methylpropyl)-tetradecylphosphanium.
