ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Tri-i-butyl(methyl)phosphonium tosylate

Catalog Number ACM374683359-1
CAS 374683-35-9
Synonyms Triisobutyl methyl phosphonium tosylate
Molecular Weight 528.81
Molecular Formula C30H57O3PS
Purity 98%
Density 1.1 g/cm3
Appearance Solid
Q&A

What is the name of Tri-i-butyl(methyl)phosphonium tosylate?

The name of Tri-i-butyl(methyl)phosphonium tosylate is Tri-i-butyl(methyl)phosphonium tosylate.

What is the molecular formula of Tri-i-butyl(methyl)phosphonium tosylate?

The molecular formula is C30H57O3PS.

What is the molecular weight of Tri-i-butyl(methyl)phosphonium tosylate?

The molecular weight is 528.8g/mol.

What is the exact mass of Tri-i-butyl(methyl)phosphonium tosylate?

The exact mass is 528.37660385.

How many heavy atoms are present in Tri-i-butyl(methyl)phosphonium tosylate?

There are 35 heavy atoms present in Tri-i-butyl(methyl)phosphonium tosylate.

What is the Canonical SMILES representation of Tri-i-butyl(methyl)phosphonium tosylate?

The Canonical SMILES representation is CCCC[C@@H](C)[P+](CCCC(C)C)(CCCC(C)C)CCCC(C)C.OS(=O)(=O)[O-].

How many covalently-bonded units are present in Tri-i-butyl(methyl)phosphonium tosylate?

There are 2 covalently-bonded units present in Tri-i-butyl(methyl)phosphonium tosylate.

How many rotatable bonds are present in Tri-i-butyl(methyl)phosphonium tosylate?

There are 17 rotatable bonds present in Tri-i-butyl(methyl)phosphonium tosylate.

What is the InChIKey of Tri-i-butyl(methyl)phosphonium tosylate?

The InChIKey is WYBDAYBFOCKDRR-UHFFFAOYSA-M.

What is the IUPAC name of Tri-i-butyl(methyl)phosphonium tosylate?

The IUPAC name is 4-methylbenzenesulfonate;methyl-bis(2-methylpropyl)-tetradecylphosphanium.

Please kindly note that our products and services are for research use only.