ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

Tin(II) trifluoromethanesulfonate

Catalog Number ACM62086048-1
CAS 62086-04-8
Structure Tin(II) trifluoromethanesulfonate
Synonyms Stannous trifluoromethanesulfonate
IUPAC Name tin(2+);trifluoromethanesulfonate;
Molecular Weight 416.9
Molecular Formula C2F6O6S2Sn
Canonical SMILES C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Sn+2]
InChI InChI=1S/2CHF3O3S.Sn/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;+2/p-2
InChI Key RBGLVWCAGPITBS-UHFFFAOYSA-L
Melting Point ≥300 °C
Purity 99%
Appearance Powder
Storage Refrigerator
Complexity 145
Covalently-Bonded Unit Count 3
Exact Mass 417.806252
Heavy Atom Count 17
Hydrogen Bond Acceptor Count 12
Hydrogen Bond Donor Count 0
Monoisotopic Mass 417.806252
Rotatable Bond Count 0
Topological Polar Surface Area 131 Ų
Q&A

What is molecular formula of Tin(II) trifluoromethanesulfonate?

C2F6O6S2Sn

What is the storage conditions of Tin(II) trifluoromethanesulfonate?

Inert atmosphere,2-8°C

What is the color of Tin(II) trifluoromethanesulfonate?

White to yellow

How is the water solubility of Tin(II) trifluoromethanesulfonate?

Insoluble in water

What is the sensitivity of Tin(II) trifluoromethanesulfonate?

Moisture sensitive

What is the stability of Tin(II) trifluoromethanesulfonate?

Hygroscopic

Please kindly note that our products and services are for research use only.