ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Tetraphenylgermane

Catalog Number ACM1048051-1
CAS 1048-05-1
Structure {[CurrentData.Name]}
Synonyms Tetraphenylgermane
IUPAC Name tetraphenylgermane;
Molecular Weight 381
Molecular Formula C24H20Ge
Canonical SMILES C1=CC=C(C=C1)[Ge](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
InChI InChI=1S/C24H20Ge/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H
InChI Key ILEXMONMGUVLRM-UHFFFAOYSA-N
Melting Point 230-235 °C
Purity 95%+
Appearance Solid
Complexity 301
Covalently-Bonded Unit Count 1
EC Number 213-880-8
Exact Mass 382.0776784
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 0
Hydrogen Bond Donor Count 0
Monoisotopic Mass 382.0776784
Rotatable Bond Count 4
Topological Polar Surface Area 0
Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is tetraphenylgermane.

What is the molecular formula of the compound?

The molecular formula of the compound is (C6H5)4Ge.

What is the molecular weight of the compound?

The molecular weight of the compound is 381.0 g/mol.

What is the CAS number of the compound?

The CAS number of the compound is 1048-05-1.

What is the InChIKey of the compound?

The InChIKey of the compound is ILEXMONMGUVLRM-UHFFFAOYSA-N.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many rotatable bond counts does the compound have?

The compound has 4 rotatable bond counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 0-2.

How many heavy atom counts does the compound have?

The compound has 25 heavy atom counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.

Please kindly note that our products and services are for research use only.