Tetraphenylgermane

Catalog Number	ACM1048051-1
CAS	1048-05-1
Structure
Synonyms	Tetraphenylgermane
IUPAC Name	tetraphenylgermane;
Molecular Weight	381
Molecular Formula	C24H20Ge
Canonical SMILES	C1=CC=C(C=C1)[Ge](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
InChI	InChI=1S/C24H20Ge/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H
InChI Key	ILEXMONMGUVLRM-UHFFFAOYSA-N
Melting Point	230-235 °C
Purity	95%+
Appearance	Solid
Complexity	301
Covalently-Bonded Unit Count	1
EC Number	213-880-8
Exact Mass	382.0776784
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	382.0776784
Rotatable Bond Count	4
Topological Polar Surface Area	0

Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is tetraphenylgermane.

What is the molecular formula of the compound?

The molecular formula of the compound is (C6H5)4Ge.

What is the molecular weight of the compound?

The molecular weight of the compound is 381.0 g/mol.

What is the CAS number of the compound?

The CAS number of the compound is 1048-05-1.

What is the InChIKey of the compound?

The InChIKey of the compound is ILEXMONMGUVLRM-UHFFFAOYSA-N.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many rotatable bond counts does the compound have?

The compound has 4 rotatable bond counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 0-2.

How many heavy atom counts does the compound have?

The compound has 25 heavy atom counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.