Tetrafluoroterephthalic acid

Catalog Number	ACM652368-2
CAS	652-36-8
Structure
Synonyms	2,3,5,6-Tetrafluoro-1,4-benzenedicarboxylic acid
IUPAC Name	2,3,5,6-tetrafluoroterephthalic acid
Molecular Weight	238.09
Molecular Formula	C6F4-1,4-(CO2H)2
Canonical SMILES	OC(=O)c1c(F)c(F)c(C(O)=O)c(F)c1F
InChI	1S/C8H2F4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16)
InChI Key	WFNRNCNCXRGUKN-UHFFFAOYSA-N
Boiling Point	337.9±42.0 °C(Predicted)
Melting Point	275-277 °C (dec.) (lit.)
Purity	0.97
Density	1.812±0.06 g/cm3(Predicted)
Appearance	Off-white solid
Application	Used for Fluorinated Hyperbranched Polymers
Storage	Store under inert gas
Complexity	264
Covalently-Bonded Unit Count	1
EC Number	211-489-7
Exact Mass	237.988921g/mol
Formal Charge	0
Heavy Atom Count	16
MDL Number	MFCD00012301
Monoisotopic Mass	237.988921g/mol
PubChem ID	24846642
Rotatable Bond Count	2

Q&A

What is the IUPAC name of Tetrafluoroterephthalic acid?

The IUPAC name of Tetrafluoroterephthalic acid is 2,3,5,6-tetrafluoroterephthalic acid.

What is the molecular weight of Tetrafluoroterephthalic acid?

The molecular weight of Tetrafluoroterephthalic acid is 238.09.

What is the SMILES notation of Tetrafluoroterephthalic acid?

The SMILES notation of Tetrafluoroterephthalic acid is OC(=O)c1c(F)c(F)c(C(O)=O)c(F)c1F.

What is the boiling point of Tetrafluoroterephthalic acid?

The predicted boiling point of Tetrafluoroterephthalic acid is 337.9±42.0 °C.

What is the melting point of Tetrafluoroterephthalic acid?

The melting point of Tetrafluoroterephthalic acid is 275-277 °C (dec.) (lit.).

What is the density of Tetrafluoroterephthalic acid?

The predicted density of Tetrafluoroterephthalic acid is 1.812±0.06 g/cm3.

What is the appearance of Tetrafluoroterephthalic acid?

Tetrafluoroterephthalic acid appears as an off-white solid.

What is the application of Tetrafluoroterephthalic acid?

Tetrafluoroterephthalic acid is used for Fluorinated Hyperbranched Polymers.

What is the purity of Tetrafluoroterephthalic acid?

The purity of Tetrafluoroterephthalic acid is 97%.

What is the packaging available for Tetrafluoroterephthalic acid?

Tetrafluoroterephthalic acid is available in 1g and 5g packaging.