Tetrafluoroterephthalic acid

Catalog Number	ACM652368-2
CAS	652-36-8
Structure
Synonyms	2,3,5,6-Tetrafluoro-1,4-benzenedicarboxylic acid
IUPAC Name	2,3,5,6-tetrafluoroterephthalic acid
Molecular Weight	238.09
Molecular Formula	C6F4-1,4-(CO2H)2
Canonical SMILES	OC(=O)c1c(F)c(F)c(C(O)=O)c(F)c1F
InChI	1S/C8H2F4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16)
InChI Key	WFNRNCNCXRGUKN-UHFFFAOYSA-N
Boiling Point	337.9±42.0 °C(Predicted)
Melting Point	275-277 °C (dec.) (lit.)
Purity	0.97
Density	1.812±0.06 g/cm3(Predicted)
Appearance	Off-white solid
Application	Used for Fluorinated Hyperbranched Polymers
Storage	Store under inert gas
Complexity	264
Covalently-Bonded Unit Count	1
EC Number	211-489-7
Exact Mass	237.988921g/mol
Formal Charge	0
Heavy Atom Count	16
MDL Number	MFCD00012301
Monoisotopic Mass	237.988921g/mol
PubChem ID	24846642
Rotatable Bond Count	2

Q&A

What is the molecular formula of Tetrafluoroterephthalic acid?

The molecular formula of Tetrafluoroterephthalic acid is C8H2F4O4.

What is the molecular weight of Tetrafluoroterephthalic acid?

The molecular weight of Tetrafluoroterephthalic acid is 238.09 g/mol.

What is the IUPAC name of Tetrafluoroterephthalic acid?

The IUPAC name of Tetrafluoroterephthalic acid is 2,3,5,6-tetrafluoroterephthalic acid.

What is the InChI of Tetrafluoroterephthalic acid?

The InChI of Tetrafluoroterephthalic acid is InChI=1S/C8H2F4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16).

What is the InChIKey of Tetrafluoroterephthalic acid?

The InChIKey of Tetrafluoroterephthalic acid is WFNRNCNCXRGUKN-UHFFFAOYSA-N.

What is the canonical SMILES of Tetrafluoroterephthalic acid?

The canonical SMILES of Tetrafluoroterephthalic acid is C1(=C(C(=C(C(=C1F)F)C(=O)O)F)F)C(=O)O.

What is the CAS number of Tetrafluoroterephthalic acid?

The CAS number of Tetrafluoroterephthalic acid is 652-36-8.

What is the European Community (EC) Number of Tetrafluoroterephthalic acid?

The European Community (EC) Number of Tetrafluoroterephthalic acid is 211-489-7.

What is the UNII of Tetrafluoroterephthalic acid?

The UNII of Tetrafluoroterephthalic acid is M6NM6WEY2H.