ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Tetra-n-butylphosphoniumiodide

Catalog Number ACM3115660-2
CAS 3115-66-0
Structure {[CurrentData.Name]}
Synonyms Tetrabutylphosphonium Iodide
IUPAC Name tetrabutylphosphanium;iodide
Molecular Weight 386.34
Molecular Formula C16H36IP
InChI CCIYPTIBRAUPLQ-UHFFFAOYSA-M
InChI Key InChI=1S/C16H36P.HI/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
Melting Point 98-100 °C
Purity 98%
Appearance Solid
Isomeric SMILES CCCC[P+](CCCC)(CCCC)CCCC.[I-]
Q&A

What is the CAS number for Tetra-n-butylphosphoniumiodide?

The CAS number for Tetra-n-butylphosphoniumiodide is 3115-66-0.

How many heavy atoms are present in the molecular formula of Tetra-n-butylphosphoniumiodide?

There are 18 heavy atoms present in the molecular formula of Tetra-n-butylphosphoniumiodide.

What is the molecular weight of Tetra-n-butylphosphoniumiodide?

The molecular weight of Tetra-n-butylphosphoniumiodide is 386.33g/mol.

How many rotatable bond counts does Tetra-n-butylphosphoniumiodide have?

Tetra-n-butylphosphoniumiodide has 12 rotatable bond counts.

Is Tetra-n-butylphosphoniumiodide a hydrogen bond donor?

No, Tetra-n-butylphosphoniumiodide is not a hydrogen bond donor.

Provide the InChIKey for Tetra-n-butylphosphoniumiodide.

The InChIKey for Tetra-n-butylphosphoniumiodide is CCIYPTIBRAUPLQ-UHFFFAOYSA-M.

What is the name of the molecular formula C16H36IP?

The name of the molecular formula C16H36IP is Tetrabutylphosphonium iodide.

How many covalently-bonded units are present in Tetra-n-butylphosphoniumiodide?

There are 2 covalently-bonded units present in Tetra-n-butylphosphoniumiodide.

What is the Monoisotopic Mass of Tetra-n-butylphosphoniumiodide?

The Monoisotopic Mass of Tetra-n-butylphosphoniumiodide is 386.15994.

Provide two Depositor-Supplied Synonyms for Tetra-n-butylphosphoniumiodide.

Two Depositor-Supplied Synonyms for Tetra-n-butylphosphoniumiodide are Tetrabutylphosphonium iodide and Tetra-n-butylphosphonium iodide.

Please kindly note that our products and services are for research use only.