Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate

Catalog Number	ACM482324389
CAS	482324-38-9
Synonyms	Bathophenanthrolinedisulfonic Acid Disodium Salt Trihydrate; 4,7-Diphenyl-1,10-Phenanthroline-3,8-Disulfonic Acid Disodium Salt
IUPAC Name	disodium;4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate
Molecular Weight	536.49
Molecular Formula	C24H14N2Na2O6S2
InChI	WWYNZTCWCJHTJF-UHFFFAOYSA-L
InChI Key	InChI=1S/C24H16N2O6S2.2Na/c27-33(28,29)19-13-25-23-17(21(19)15-7-3-1-4-8-15)11-12-18-22(16-9-5-2-6-10-16)20(34(30,31)32)14-26-24(18)23;;/h1-14H,(H,27,28,29)(H,30,31,32);;/q;2*+1/p-2
Purity	98%
Isomeric SMILES	C1=CC=C(C=C1)C2=C3C=CC4=C(C(=CN=C4C3=NC=C2S(=O)(=O)[O-])S(=O)(=O)[O-])C5=CC=CC=C5.[Na+].[Na+]

Q&A

What is the chemical formula of Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate?

The chemical formula is C24H17N2NaO6S2.

What is the molecular weight of Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate?

The molecular weight is 516.52 g/mol.

Is Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate a common synonym for this compound?

Yes, Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate is a common synonym.

What is the CAS number of Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate?

The CAS number is 482324-38-9.

How many sodium atoms are present in a molecule of Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate?

There is one sodium atom present.

What are the elements present in the chemical formula of Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate?

The elements present are carbon, hydrogen, nitrogen, oxygen, sodium, and sulfur.

What is the chemical structure of Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate?

The chemical structure is a complex phenanthroline derivative with sodium and disulfonate groups attached.

What functional groups are present in the structure of Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate?

Phenyl, phenanthroline, disulfonate, and sodium groups are present as functional groups in the structure.

Can Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate form coordination complexes with metal ions?

Yes, Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate can form coordination complexes with various metal ions due to its structural properties.

What are some potential uses of Sodium 4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate in chemical applications?

It can be used as a ligand in coordination chemistry, as a sensor for certain metal ions, or as a fluorescent probe in analytical chemistry.