Salcomin

Catalog Number	ACM14167181-1
CAS	14167-18-1
Structure
Synonyms	Cobalt(2+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate
Molecular Weight	325.23
Molecular Formula	C16H14CoN2O2
Canonical SMILES	C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2[O-])[O-].[Co+2]
InChI	InChI=1S/C16H16N2O2.Co/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/q;+2/p-2
InChI Key	NPAQSKHBTMUERN-UHFFFAOYSA-L
Melting Point	>300 °C
Purity	95%
Exact Mass	325.038721
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	325.038721
Rotatable Bond Count	5
Topological Polar Surface Area	70.8 Ų

Q&A

What is the product name of the compound with the CAS number 14167-18-1?

The product name is Salcomine.

What is the chemical formula of Salcomine?

The chemical formula is C16H14CoN2O2.

What is the color of Salcomine?

Salcomine is orange to amber to dark red in color.

What is the melting point of Salcomine?

The melting point of Salcomine is greater than 300 °C.

In what type of solvents is Salcomine soluble?

Salcomine is soluble in benzene, chloroform, and pyridine, but insoluble in water.

What is the general description of Salcomine?

Salcomine is a solid complex between the cobalt(II) ion and the condensation product of salicylaldehyde and ethylenediamine, known as a Schiff's base. It is used as a catalyst for oxidation reactions.

How should Salcomine be stored?

Salcomine should be stored in an inert atmosphere at room temperature.

What are some hazardous substances data associated with Salcomine?

The hazardous substances data for Salcomine include risk statements 36/37/38 and safety statements 26-36.

What is the toxicity of Salcomine to mice, as?

The toxicity of Salcomine to mice is represented by an LCLo (lowest published lethal concentration) of 390 mg/m3/5.5h for inhalation, causing lung and respiratory issues.

How is Salcomine purified?

Salcomine can be purified by crystallization from pyridine, CHCl3 or C6H6, with the solvent removed by heating in a vacuum at 120o.