(S)-(+)-Neomenthyldiphenylphosphine

Catalog Number	ACM43077298-1
CAS	43077-29-8
Structure
Synonyms	(1S,2S,5R)-(+)-Neomenthyldiphenylphosphine
IUPAC Name	[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-diphenylphosphane
Molecular Weight	324.45
Molecular Formula	C22H29P
InChI	BEYDOEXXFGNVRZ-COPCDDAFSA-N
InChI Key	InChI=1S/C22H29P/c1-17(2)21-15-14-18(3)16-22(21)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3/t18-,21+,22+/m1/s1
Boiling Point	414.7±14.0 °C(Predicted)
Melting Point	95-99 °C
Flash Point	216.1ºC
Purity	98%
Appearance	Solid
Exact Mass	324.20100
Isomeric SMILES	C[C@@H]1CC[C@H]([C@H](C1)P(C2=CC=CC=C2)C3=CC=CC=C3)C(C)C

Q&A

What is the CAS number of (S)-(+)-Neomenthyldiphenylphosphine?

The CAS number is 43077-29-8.

What is the molecular formula of (S)-(+)-Neomenthyldiphenylphosphine?

The molecular formula is C22H29P.

What is the molecular weight of (S)-(+)-Neomenthyldiphenylphosphine?

The molecular weight is 324.4 g/mol.

How many heavy atoms are present in (S)-(+)-Neomenthyldiphenylphosphine?

There are 23 heavy atoms in the compound.

Does (S)-(+)-Neomenthyldiphenylphosphine have any hydrogen bond acceptor count?

No, it does not have a hydrogen bond acceptor count.

What is the XLogP3 value of (S)-(+)-Neomenthyldiphenylphosphine?

The XLogP3 value is 6.5.

What is the InChIKey of (S)-(+)-Neomenthyldiphenylphosphine?

The InChIKey is BEYDOEXXFGNVRZ-COPCDDAFSA-N.

How many atom stereocenters are defined in the structure of (S)-(+)-Neomenthyldiphenylphosphine?

There are 3 defined atom stereocenters.

What is the exact mass of (S)-(+)-Neomenthyldiphenylphosphine?

The exact mass is 324.200687923.

Are there any depositor-supplied synonyms for (S)-(+)-Neomenthyldiphenylphosphine?

Yes, there are several synonyms provided by the depositor, such as "DTXSID50370366" and "CS-W009871".