(S)-2-((Diphenylphosphino)methyl)pyrrolidine

Catalog Number	ACM60261463-1
CAS	60261-46-3
Structure
Synonyms	Diphenyl-[[(2S)-Pyrrolidin-2-Yl]Methyl]Phosphane
IUPAC Name	diphenyl-[[(2S)-pyrrolidin-2-yl]methyl]phosphane
Molecular Weight	269.32
Molecular Formula	C17H20NP
InChI	IWRBGJKCDORZHK-HNNXBMFYSA-N
InChI Key	InChI=1S/C17H20NP/c1-3-9-16(10-4-1)19(14-15-8-7-13-18-15)17-11-5-2-6-12-17/h1-6,9-12,15,18H,7-8,13-14H2/t15-/m0/s1
Boiling Point	387.1±15.0 °C(Predicted)
Flash Point	>110 °C
Purity	98%
Density	1.043 g/mL at 25 °C
Appearance	Liquid
Isomeric SMILES	C1C[C@H](NC1)CP(C2=CC=CC=C2)C3=CC=CC=C3
pKa	10.46±0.10(Predicted)

Q&A

What is the IUPAC name of (S)-2-((Diphenylphosphino)methyl)pyrrolidine?

The IUPAC name is diphenyl-[[(2S)-pyrrolidin-2-yl]methyl]phosphane.

What is the molecular formula of (S)-2-((Diphenylphosphino)methyl)pyrrolidine?

The molecular formula is C17H20NP.

What is the exact mass of (S)-2-((Diphenylphosphino)methyl)pyrrolidine?

The exact mass is 269.133336640.

What is the Monoisotopic Mass of (S)-2-((Diphenylphosphino)methyl)pyrrolidine?

The Monoisotopic Mass is 269.133336640.

How many hydrogen bond acceptors does (S)-2-((Diphenylphosphino)methyl)pyrrolidine have?

The compound has 1 hydrogen bond acceptor.

What is the Canonical SMILES representation of (S)-2-((Diphenylphosphino)methyl)pyrrolidine?

The Canonical SMILES is C1CC(NC1)CP(C2=CC=CC=C2)C3=CC=CC=C3.

What is the CAS number of (S)-2-((Diphenylphosphino)methyl)pyrrolidine?

The CAS number is 60261-46-3.

How many heavy atoms are present in (S)-2-((Diphenylphosphino)methyl)pyrrolidine?

There are 19 heavy atoms.

Is (S)-2-((Diphenylphosphino)methyl)pyrrolidine a defined atom stereocenter count?

Yes, (S)-2-((Diphenylphosphino)methyl)pyrrolidine has 1 defined atom stereocenter count.

What is the topological polar surface area of (S)-2-((Diphenylphosphino)methyl)pyrrolidine?

The topological polar surface area is 12.