ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(R,R,R,R)-BIBOP

Catalog Number ACMA00040944
Molecular Weight 386.40
Molecular Formula C22H28O2P2
Purity 97%
Q&A

What is the IUPAC name of (R,R,R,R)-BIBOP?

The IUPAC name of (R,R,R,R)-BIBOP is "(2R,3R)-3-tert-butyl-2-[(2R,3R)-3-tert-butyl-2H-1,3-benzoxaphosphol-2-yl]-2H-1,3-benzoxaphosphole".

What is the molecular formula of (R,R,R,R)-BIBOP?

The molecular formula of (R,R,R,R)-BIBOP is C22H28O2P2.

What is the exact mass of (R,R,R,R)-BIBOP?

The exact mass of (R,R,R,R)-BIBOP is 386.15645413.

What is the Canonical SMILES representation of (R,R,R,R)-BIBOP?

The Canonical SMILES representation of (R,R,R,R)-BIBOP is "CC(C)(C)P1C(OC2=CC=CC=C21)C3OC4=CC=CC=C4P3C(C)(C)C".

What is the molecular weight of (R,R,R,R)-BIBOP?

The molecular weight of (R,R,R,R)-BIBOP is 386.4g/mol.

What is the Computed Properties Heavy Atom Count of (R,R,R,R)-BIBOP?

The Computed Properties Heavy Atom Count of (R,R,R,R)-BIBOP is 26.

What is the Depositor-Supplied Synonyms of (R,R,R,R)-BIBOP?

The Depositor-Supplied Synonyms of (R,R,R,R)-BIBOP include "(2R,2'R,3R,3'R)-BIBOP", "SCHEMBL13517314", and "CS-0088635".

What is the InChIKey of (R,R,R,R)-BIBOP?

The InChIKey of (R,R,R,R)-BIBOP is "CAVTUIDTRDJLGP-DOOQXGAZSA-N".

What is the Computed Properties Topological Polar Surface Area of (R,R,R,R)-BIBOP?

The Computed Properties Topological Polar Surface Area of (R,R,R,R)-BIBOP is 18.5.

Please kindly note that our products and services are for research use only.