What is the IUPAC name of (R,R,R,R)-BIBOP?
The IUPAC name of (R,R,R,R)-BIBOP is "(2R,3R)-3-tert-butyl-2-[(2R,3R)-3-tert-butyl-2H-1,3-benzoxaphosphol-2-yl]-2H-1,3-benzoxaphosphole".
What is the molecular formula of (R,R,R,R)-BIBOP?
The molecular formula of (R,R,R,R)-BIBOP is C22H28O2P2.
What is the exact mass of (R,R,R,R)-BIBOP?
The exact mass of (R,R,R,R)-BIBOP is 386.15645413.
What is the Canonical SMILES representation of (R,R,R,R)-BIBOP?
The Canonical SMILES representation of (R,R,R,R)-BIBOP is "CC(C)(C)P1C(OC2=CC=CC=C21)C3OC4=CC=CC=C4P3C(C)(C)C".
What is the molecular weight of (R,R,R,R)-BIBOP?
The molecular weight of (R,R,R,R)-BIBOP is 386.4g/mol.
What is the Computed Properties Heavy Atom Count of (R,R,R,R)-BIBOP?
The Computed Properties Heavy Atom Count of (R,R,R,R)-BIBOP is 26.
What is the Depositor-Supplied Synonyms of (R,R,R,R)-BIBOP?
The Depositor-Supplied Synonyms of (R,R,R,R)-BIBOP include "(2R,2'R,3R,3'R)-BIBOP", "SCHEMBL13517314", and "CS-0088635".
What is the InChIKey of (R,R,R,R)-BIBOP?
The InChIKey of (R,R,R,R)-BIBOP is "CAVTUIDTRDJLGP-DOOQXGAZSA-N".
What is the Computed Properties Topological Polar Surface Area of (R,R,R,R)-BIBOP?
The Computed Properties Topological Polar Surface Area of (R,R,R,R)-BIBOP is 18.5.
