(R)-DTB-SIPHOX

Catalog Number	ACMA00040939
Molecular Weight	697.99
Molecular Formula	C48H60NOP
Purity	98%

Q&A

What is the Canonical SMILES representation of (R)-DTB-SIPHOX?

The Canonical SMILES representation of (R)-DTB-SIPHOX is: CC(C)(C)C1=CC(=CC(=C1)P(C2=CC=CC3=C2C4(CCC5=C4C(=CC=C5)C6=NCCO6)CC3)C7=CC(=CC(=C7)C(C)(C)C)C(C)(C)C)C(C)(C)C

What is the XLogP3 value of (R)-DTB-SIPHOX?

The XLogP3 value of (R)-DTB-SIPHOX is 13.7.

How many Heavy Atoms are present in the (R)-DTB-SIPHOX molecule?

There are 51 Heavy Atoms present in the (R)-DTB-SIPHOX molecule.

What is the IUPAC Name of (R)-DTB-SIPHOX?

The IUPAC Name of (R)-DTB-SIPHOX is bis(3,5-ditert-butylphenyl)-[(3R)-4-(4,5-dihydro-1,3-oxazol-2-yl)-3,3'-spirobi[1,2-dihydroindene]-4'-yl]phosphane.

What is the Molecular Formula of (R)-DTB-SIPHOX?

The Molecular Formula of (R)-DTB-SIPHOX is C48H60NOP.

What is the Exact Mass of (R)-DTB-SIPHOX?

The Exact Mass of (R)-DTB-SIPHOX is 697.44125254.

How many Rotatable Bonds are present in the (R)-DTB-SIPHOX molecule?

There are 8 Rotatable Bonds present in the (R)-DTB-SIPHOX molecule.

How many Covalently-Bonded Units are present in the (R)-DTB-SIPHOX molecule?

There is 1 Covalently-Bonded Unit present in the (R)-DTB-SIPHOX molecule.