ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

(R)-(+)-5,5'-Bis(diphenylphosphino)-4,4'-bi-1,3-benzodioxole

Catalog Number ACM244261663-1
CAS 244261-66-3
Structure (R)-(+)-5,5'-Bis(diphenylphosphino)-4,4'-bi-1,3-benzodioxole
Synonyms [4(R)-(4,4'-bi-1,3-benzodioxole)-5,5'-diyl]bis[diphenylphosphine]; (R)-SEGPHOS
IUPAC Name [4-(5-diphenylphosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]-diphenylphosphane
Molecular Weight 610.57
Molecular Formula C38H28O4P2
InChI RZZDRSHFIVOQAF-UHFFFAOYSA-N
InChI Key InChI=1S/C38H28O4P2/c1-5-13-27(14-6-1)43(28-15-7-2-8-16-28)33-23-21-31-37(41-25-39-31)35(33)36-34(24-22-32-38(36)42-26-40-32)44(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-24H,25-26H2
Boiling Point 715.4±60.0 °C(Predicted)
Melting Point 168-172 °C
Purity 98%+
Appearance Solid
Isomeric SMILES C1OC2=C(O1)C(=C(C=C2)P(C3=CC=CC=C3)C4=CC=CC=C4)C5=C(C=CC6=C5OCO6)P(C7=CC=CC=C7)C8=CC=CC=C8
Q&A

What is the chemical structure of Segphos?

The chemical structure of Segphos is [4-(5-diphenylphosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]-diphenylphosphane.

What is the CAS number of Segphos?

The CAS numbers of Segphos are 210169-54-3 and 244261-66-3.

What is the exact mass of Segphos?

The exact mass of Segphos is 610.14628337 g/mol.

What is the molecular formula of Segphos?

The molecular formula of Segphos is C38H28O4P2.

How many heavy atoms are present in the Segphos molecule?

There are 44 heavy atoms present in the Segphos molecule.

Does Segphos contain any hydrogen bond donor groups?

No, Segphos does not contain any hydrogen bond donor groups.

What is the topological polar surface area of Segphos?

The topological polar surface area of Segphos is 36.9.

What are some synonyms for Segphos?

Some synonyms for Segphos include (R)-SEGPHOS, (S)-SEGPHOS, (S)-(-)-SEGPHOS, and (R)-(+)-SEGPHOS.

Is Segphos a chiral molecule?

Yes, Segphos is a chiral molecule.

What is the InChIKey of Segphos?

The InChIKey of Segphos is RZZDRSHFIVOQAF-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.