What is the PubChem CID for (R)-(+)-4-Isopropyl-2-oxazolidinone?
The PubChem CID for (R)-(+)-4-Isopropyl-2-oxazolidinone is 641505.
What is the molecular formula of (R)-(+)-4-Isopropyl-2-oxazolidinone?
The molecular formula of (R)-(+)-4-Isopropyl-2-oxazolidinone is C6H11NO2.
What is the molecular weight of (R)-(+)-4-Isopropyl-2-oxazolidinone?
The molecular weight of (R)-(+)-4-Isopropyl-2-oxazolidinone is 129.16 g/mol.
What is the IUPAC name of (R)-(+)-4-Isopropyl-2-oxazolidinone?
The IUPAC name of (R)-(+)-4-Isopropyl-2-oxazolidinone is (4R)-4-propan-2-yl-1,3-oxazolidin-2-one.
What is the InChI of (R)-(+)-4-Isopropyl-2-oxazolidinone?
The InChI of (R)-(+)-4-Isopropyl-2-oxazolidinone is InChI=1S/C6H11NO2/c1-4(2)5-3-9-6(8)7-5/h4-5H,3H2,1-2H3,(H,7,8)/t5-/m0/s1.
What is the InChIKey of (R)-(+)-4-Isopropyl-2-oxazolidinone?
The InChIKey of (R)-(+)-4-Isopropyl-2-oxazolidinone is YBUPWRYTXGAWJX-YFKPBYRVSA-N.
What is the canonical SMILES of (R)-(+)-4-Isopropyl-2-oxazolidinone?
The canonical SMILES of (R)-(+)-4-Isopropyl-2-oxazolidinone is CC(C)C1COC(=O)N1.
How many hydrogen bond donor counts does (R)-(+)-4-Isopropyl-2-oxazolidinone have?
(R)-(+)-4-Isopropyl-2-oxazolidinone has 1 hydrogen bond donor count.
What is the XLogP3-AA value of (R)-(+)-4-Isopropyl-2-oxazolidinone?
The XLogP3-AA value of (R)-(+)-4-Isopropyl-2-oxazolidinone is 1.1.
Is (R)-(+)-4-Isopropyl-2-oxazolidinone a canonicalized compound?
Yes, (R)-(+)-4-Isopropyl-2-oxazolidinone is a canonicalized compound according to PubChem.