ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

(R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine

Catalog Number ACMA00040936
Molecular Weight 374.37
Molecular Formula C23H19O3P
Purity 98%
Q&A

What is the molecular formula of (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

The molecular formula is C23H19O3P.

What is the molecular weight of (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

The molecular weight is 374.4g/mol.

What is the exact mass of (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

The exact mass is 374.10718146.

How many heavy atoms are present in the structure of (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

There are 27 heavy atoms.

What is the XLogP3 value for (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

The XLogP3 value is 6.6.

How many rotatable bonds are present in (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

There are 2 rotatable bonds.

What is the Canonical SMILES representation of (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

The Canonical SMILES is CC(C)OC1=CC=CC2=C1C=CC3=C2C4=C(C=CC5=CC=CC=C54)OPO3.

How many hydrogen bond acceptors are present in the structure of (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

There are 3 hydrogen bond acceptors.

What is the InChIKey for (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

The InChIKey is ZIPQMQRVCJMLMU-UHFFFAOYSA-N.

What is the IUPAC name of (R)-4-Isopropoxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine?

The IUPAC name is 7-propan-2-yloxy-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18,20,22-decaene.

Please kindly note that our products and services are for research use only.