What is the CAS number for (R)-2-(Diphenylphosphino)-1-phenylethylamine (R)-2-(Diphenylphosphino)-1-phenylethylamine?
The CAS number is 141096-35-7.
What is the Canonical SMILES representation of (R)-2-(Diphenylphosphino)-1-phenylethylamine?
The Canonical SMILES is C1=CC=C(C=C1)C(CP(C2=CC=CC=C2)C3=CC=CC=C3)N.
How many defined atom stereocenter counts does (R)-2-(Diphenylphosphino)-1-phenylethylamine have?
It has 1 defined atom stereocenter.
What is the molecular weight of (R)-2-(Diphenylphosphino)-1-phenylethylamine?
The molecular weight is 305.4 g/mol.
What is the IUPAC Name of (R)-2-(Diphenylphosphino)-1-phenylethylamine?
The IUPAC Name is (1R)-2-diphenylphosphanyl-1-phenylethanamine.
How many hydrogen bond donor counts does (R)-2-(Diphenylphosphino)-1-phenylethylamine have?
It has 1 hydrogen bond donor count.
What is the XLogP3 value of (R)-2-(Diphenylphosphino)-1-phenylethylamine?
The XLogP3 value is 3.6.
What is the InChIKey for (R)-2-(Diphenylphosphino)-1-phenylethylamine?
The InChIKey is OTNYDYNCOCRMDG-FQEVSTJZSA-N.
How many rotatable bond counts does (R)-2-(Diphenylphosphino)-1-phenylethylamine have?
It has 5 rotatable bond counts.
What is the Monoisotopic Mass of (R)-2-(Diphenylphosphino)-1-phenylethylamine?
The Monoisotopic Mass is 305.133336640.