ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

(R)-2-(Diphenylphosphino)-1-phenylethylamine

Catalog Number ACM141096357-1
CAS 141096-35-7
Structure (R)-2-(Diphenylphosphino)-1-phenylethylamine
Synonyms (1R)-2-diphenylphosphanyl-1-phenylethanamine; (1R)-2-(Diphenylphosphanyl)-1-phenylethan-1-amine
IUPAC Name (1R)-2-diphenylphosphanyl-1-phenylethanamine
Molecular Weight 305.35
Molecular Formula C20H20NP
InChI OTNYDYNCOCRMDG-FQEVSTJZSA-N
InChI Key InChI=1S/C20H20NP/c21-20(17-10-4-1-5-11-17)16-22(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20H,16,21H2/t20-/m0/s1
Boiling Point 445.3±38.0 °C(Predicted)
Purity 98%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)[C@H](CP(C2=CC=CC=C2)C3=CC=CC=C3)N
pKa 8.38±0.10(Predicted)
Q&A

What is the CAS number for (R)-2-(Diphenylphosphino)-1-phenylethylamine (R)-2-(Diphenylphosphino)-1-phenylethylamine?

The CAS number is 141096-35-7.

What is the Canonical SMILES representation of (R)-2-(Diphenylphosphino)-1-phenylethylamine?

The Canonical SMILES is C1=CC=C(C=C1)C(CP(C2=CC=CC=C2)C3=CC=CC=C3)N.

How many defined atom stereocenter counts does (R)-2-(Diphenylphosphino)-1-phenylethylamine have?

It has 1 defined atom stereocenter.

What is the molecular weight of (R)-2-(Diphenylphosphino)-1-phenylethylamine?

The molecular weight is 305.4 g/mol.

What is the IUPAC Name of (R)-2-(Diphenylphosphino)-1-phenylethylamine?

The IUPAC Name is (1R)-2-diphenylphosphanyl-1-phenylethanamine.

How many hydrogen bond donor counts does (R)-2-(Diphenylphosphino)-1-phenylethylamine have?

It has 1 hydrogen bond donor count.

What is the XLogP3 value of (R)-2-(Diphenylphosphino)-1-phenylethylamine?

The XLogP3 value is 3.6.

What is the InChIKey for (R)-2-(Diphenylphosphino)-1-phenylethylamine?

The InChIKey is OTNYDYNCOCRMDG-FQEVSTJZSA-N.

How many rotatable bond counts does (R)-2-(Diphenylphosphino)-1-phenylethylamine have?

It has 5 rotatable bond counts.

What is the Monoisotopic Mass of (R)-2-(Diphenylphosphino)-1-phenylethylamine?

The Monoisotopic Mass is 305.133336640.

Please kindly note that our products and services are for research use only.