ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole

Catalog Number ACM508228851
CAS 508228-85-1
Synonyms (4R)-2,4,5,5-Tetraphenyl-4H-1,3-oxazole
IUPAC Name (4R)-2,4,5,5-tetraphenyl-4H-1,3-oxazole
Molecular Weight 375.46
Molecular Formula C27H21NO
InChI UNNYKNMHFWMHCG-RUZDIDTESA-N
InChI Key InChI=1S/C27H21NO/c1-5-13-21(14-6-1)25-27(23-17-9-3-10-18-23,24-19-11-4-12-20-24)29-26(28-25)22-15-7-2-8-16-22/h1-20,25H/t25-/m1/s1
Purity 98%
Isomeric SMILES C1=CC=C(C=C1)[C@@H]2C(OC(=N2)C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5
Q&A

What is the chemical structure of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The chemical structure of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is C27H21NO.

What are the synonyms for (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The synonyms for (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole are Oxazole, 4,5-dihydro-2,4,5,5-tetraphenyl-, (4R)- and (4R)-4,5-Dihydro-2,4,5,5-tetraphenyloxazole.

What is the molecular weight of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The molecular weight of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is 375.46 g/mol.

What is the boiling point of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The boiling point of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is predicted to be 512.7 ± 50.0 °C.

What is the pka value of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The pka value of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is predicted to be 2.88 ± 0.70.

What is the predicted density of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The predicted density of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is 1.10 ± 0.1 g/cm3.

How many phenyl groups are present in the structure of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

There are four phenyl groups present in the structure of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole.

What is the chemical formula of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The chemical formula of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is C27H21NO.

What is the stereochemistry of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The stereochemistry of (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is (4R).

What is the CAS number for (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The CAS number for (R)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is 508228-85-1.

Please kindly note that our products and services are for research use only.