(R)-2-([2,2'-Bipyridin]-6-yl)-4-phenyl-4,5-dihydrooxazole

Catalog Number	ACM1666123701
CAS	1666123-70-1
Synonyms	6-[(R)-4alpha-Phenyl-2-Oxazoline-2-Yl]-2,2'-Bipyridine; (4R)-4-phenyl-2-(6-pyridin-2-ylpyridin-2-yl)-4,5-dihydro-1,3-oxazole
IUPAC Name	(4R)-4-phenyl-2-(6-pyridin-2-ylpyridin-2-yl)-4,5-dihydro-1,3-oxazole
Molecular Weight	301.34
Molecular Formula	C19H15N3O
InChI	QYXGHXWEYNBAAR-SFHVURJKSA-N
InChI Key	InChI=1S/C19H15N3O/c1-2-7-14(8-3-1)18-13-23-19(22-18)17-11-6-10-16(21-17)15-9-4-5-12-20-15/h1-12,18H,13H2/t18-/m0/s1
Purity	98%
Isomeric SMILES	C1[C@H](N=C(O1)C2=CC=CC(=N2)C3=CC=CC=N3)C4=CC=CC=C4

Q&A

What is the CAS number for the compound with the chemical formula C19H15N3O?

The CAS number is 1666123-70-1.

What is the molecular weight of the compound?

The molecular weight is 301.34.

What is the product name of the compound?

The product name is 2,2'-Bipyridine, 6-[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]-.

What are some synonyms for the compound?

Some synonyms are 2,2'-Bipyridine, 6-[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]-, (R)-2-([2,2'-Bipyridin]-6-yl)-4-phenyl-4,5-dihydrooxazole, 2-([2,2'-Bipyridin]-6-yl)-4-phenyloxazole, (R)-2-([2,2'-Bipyridin]-6-yl)-4-phenyl-4,5-dihydrooxazole.

What is the molecular formula of the compound?

The molecular formula is C19H15N3O.

What is the predicted boiling point of the compound?

The predicted boiling point is 518.0±50.0 °C.

What is the predicted pKa value of the compound?

The predicted pKa value is 3.90±0.29.

What is the predicted density of the compound?

The predicted density is 1.22±0.1 g/cm3.

What is the predicted structure of the compound?

The predicted structure is (R)-2-([2,2'-Bipyridin]-6-yl)-4-phenyl-4,5-dihydrooxazole.

How many nitrogen atoms are present in the compound?

There are three nitrogen atoms in the compound.