Pyridine-2,6-diyldimethanamine

Catalog Number	ACM34984162-2
CAS	34984-16-2
Structure
Synonyms	2,6-Pyridinedimethanamine; 2,6-Bis-(Aminomethyl)-Pyridine; [6-(Aminomethyl)Pyridin-2-Yl]Methanamine
IUPAC Name	[6-(aminomethyl)pyridin-2-yl]methanamine
Molecular Weight	137.18
Molecular Formula	C7H11N3
InChI	SCAKSBRUOMUBFL-UHFFFAOYSA-N
InChI Key	InChI=1S/C7H11N3/c8-4-6-2-1-3-7(5-9)10-6/h1-3H,4-5,8-9H2
Boiling Point	257.5±30.0 °C(Predicted)
Purity	98%
Appearance	Solid
Isomeric SMILES	C1=CC(=NC(=C1)CN)CN

Q&A

What is the molecular weight of Pyridine-2,6-diyldimethanamine?

The molecular weight of Pyridine-2,6-diyldimethanamine is 137.18.

What are the product categories that Pyridine-2,6-diyldimethanamine belongs to?

Pyridine-2,6-diyldimethanamine belongs to Achiral Nitrogen and Py-N product categories.

What is another name for Pyridine-2,6-diyldimethanamine?

Another name for Pyridine-2,6-diyldimethanamine is 2,6-Pyridinedimethanamine.

What is the chemical formula of Pyridine-2,6-diyldimethanamine?

The chemical formula of Pyridine-2,6-diyldimethanamine is C7H11N3.

What is the predicted boiling point of Pyridine-2,6-diyldimethanamine?

The predicted boiling point of Pyridine-2,6-diyldimethanamine is 257.5±30.0 °C.

What is the predicted pka value of Pyridine-2,6-diyldimethanamine?

The predicted pka value of Pyridine-2,6-diyldimethanamine is 8.99±0.39.

What is the color of Pyridine-2,6-diyldimethanamine?

Pyridine-2,6-diyldimethanamine has a low melting yellow color.

What is the predicted density of Pyridine-2,6-diyldimethanamine?

The predicted density of Pyridine-2,6-diyldimethanamine is 1.118±0.06 g/cm3.

In what form does Pyridine-2,6-diyldimethanamine exist?

Pyridine-2,6-diyldimethanamine exists in a solid form.

Is Pyridine-2,6-diyldimethanamine air sensitive?

Yes, Pyridine-2,6-diyldimethanamine is air sensitive.