Platinum nitrate

Catalog Number	ACM18496407-3
CAS	18496-40-7
Structure
Synonyms	Platinum(2+);dinitrate
Molecular Weight	319.09
Molecular Formula	N4O12Pt
Canonical SMILES	[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Pt+2]
InChI	InChI=1S/2NO3.Pt/c2*2-1(3)4;/q2*-1;+2
InChI Key	NWAHZABTSDUXMJ-UHFFFAOYSA-N
Appearance	Brown red liquid
Complexity	18.8
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	318.94043
Heavy Atom Count	9
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	0
Monoisotopic Mass	318.94043
Rotatable Bond Count	0
Topological Polar Surface Area	126 Ų

Q&A

What is the molecular weight of Platinum nitrate?

The molecular weight of Platinum nitrate is 319.09.

What are the product categories of Platinum nitrate?

The product categories of Platinum nitrate are chemical reaction, pharma, electronic, and materials.

What is the water solubility of Platinum nitrate?

Platinum nitrate is soluble in water.

What is the color of Platinum nitrate?

The color of Platinum nitrate is orange-brown.

What are some synonyms of Platinum nitrate?

Some synonyms of Platinum nitrate are Platinum (II) nitrate - solution, Pt(NO3)2, 50%Pt, Platinous nitrate, and Platinum dinitrate.

What is the chemical formula of Platinum nitrate?

The chemical formula of Platinum nitrate is N4O12Pt.

What are some uses of Platinum nitrate?

Platinum nitrate is used for purifying the exhaust gas of automobiles and motorcycles, as an intermediate for the preparation of other homogeneous catalysts, and as a catalyst raw material for petrochemical and fine chemical industries.

What is the form of Platinum nitrate?

Platinum nitrate is in the form of a solution.

What is the CAS DataBase reference for Platinum nitrate?

The CAS DataBase reference for Platinum nitrate is 18496-40-7.

What are some chemical properties of Platinum nitrate?

Platinum nitrate is a reddish-brown liquid used to prepare palladium-containing compounds, heterogeneous catalysts, and coatings of material surfaces. It is also susceptible to hydrolysis leading to gel formation and precipitation of orange Pt (IV) oxide.