ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Phosphonium,tetrakis(hydroxymethyl)-, chloride

Catalog Number ACM359406896
CAS 359406-89-6
Synonyms Tetrakis(Hydroxymethyl)Phosphonium Chloride
Molecular Weight 190.56
Molecular Formula C4H12ClO4P
Purity 98%
Q&A

What is the CAS number for Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The CAS number for Phosphonium, tetrakis(hydroxymethyl)-, chloride is 124-64-1.

What is the molecular formula of Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The molecular formula of Phosphonium, tetrakis(hydroxymethyl)-, chloride is C4H12O4P.Cl.

What are the Computed Properties of Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The Computed Properties include: Complexity: 55.5; Covalently-Bonded Unit Count: 2; Heavy Atom Count: 10

How many Hydrogen Bond Acceptor Count does Phosphonium, tetrakis(hydroxymethyl)-, chloride have?

Phosphonium, tetrakis(hydroxymethyl)-, chloride has 5 Hydrogen Bond Acceptor Count.

What is the Canonical SMILES for Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The Canonical SMILES for Phosphonium, tetrakis(hydroxymethyl)-, chloride is C(O)[P+](CO)(CO)CO.[Cl-].

What are the Depositor-Supplied Synonyms for Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The Depositor-Supplied Synonyms include THPC, Pyroset TKC, Tetrakis(hydroxymethyl)phosphonium chloride, and more.

What is the IUPAC Name of Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The IUPAC Name of Phosphonium, tetrakis(hydroxymethyl)-, chloride is tetrakis(hydroxymethyl)phosphanium;chloride.

What is the UN Number for Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The UN Number for Phosphonium, tetrakis(hydroxymethyl)-, chloride is 2810.

What is the molecular weight of Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The molecular weight of Phosphonium, tetrakis(hydroxymethyl)-, chloride is 190.56g/mol.

What is the MeSH Entry Term for Phosphonium, tetrakis(hydroxymethyl)-, chloride?

The MeSH Entry Term includes tetramethylolphosphonium acetate, tetramethylolphosphonium chloride, tetramethylolphosphonium hydroxide, and more.

Please kindly note that our products and services are for research use only.