What is the CAS number for Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The CAS number for Phosphonium, tetrakis(hydroxymethyl)-, chloride is 124-64-1.
What is the molecular formula of Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The molecular formula of Phosphonium, tetrakis(hydroxymethyl)-, chloride is C4H12O4P.Cl.
What are the Computed Properties of Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The Computed Properties include: Complexity: 55.5; Covalently-Bonded Unit Count: 2; Heavy Atom Count: 10
How many Hydrogen Bond Acceptor Count does Phosphonium, tetrakis(hydroxymethyl)-, chloride have?
Phosphonium, tetrakis(hydroxymethyl)-, chloride has 5 Hydrogen Bond Acceptor Count.
What is the Canonical SMILES for Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The Canonical SMILES for Phosphonium, tetrakis(hydroxymethyl)-, chloride is C(O)[P+](CO)(CO)CO.[Cl-].
What are the Depositor-Supplied Synonyms for Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The Depositor-Supplied Synonyms include THPC, Pyroset TKC, Tetrakis(hydroxymethyl)phosphonium chloride, and more.
What is the IUPAC Name of Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The IUPAC Name of Phosphonium, tetrakis(hydroxymethyl)-, chloride is tetrakis(hydroxymethyl)phosphanium;chloride.
What is the UN Number for Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The UN Number for Phosphonium, tetrakis(hydroxymethyl)-, chloride is 2810.
What is the molecular weight of Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The molecular weight of Phosphonium, tetrakis(hydroxymethyl)-, chloride is 190.56g/mol.
What is the MeSH Entry Term for Phosphonium, tetrakis(hydroxymethyl)-, chloride?
The MeSH Entry Term includes tetramethylolphosphonium acetate, tetramethylolphosphonium chloride, tetramethylolphosphonium hydroxide, and more.
