What is the Depositor-Supplied Synonym for Phosphine with the exact mass of 558.211252606?
The Depositor-Supplied Synonym for Phosphine with the exact mass of 558.211252606 is (S)-[2'-(2-Methoxybenzyl)-[1,1'-binaphthalen]-2-yl]diphenylphosphine.
How many heavy atoms are present in the Computed Properties of Phosphine?
There are 42 heavy atoms present in the Computed Properties of Phosphine.
What is the Canonical SMILES representation of Phosphine?
The Canonical SMILES representation of Phosphine is COC1=CC=CC=C1CC2=C(C3=CC=CC=C3C=C2)C4=C(C=CC5=CC=CC=C54)P(C6=CC=CC=C6)C7=CC=CC=C7
What is the Molecular Weight of Phosphine?
The Molecular Weight of Phosphine is 558.6g/mol.
How many Rotatable Bond Counts does Phosphine have?
Phosphine has 7 Rotatable Bond Counts.
What is the IUPAC Name of Phosphine?
The IUPAC Name of Phosphine is [1-[2-[(2-methoxyphenyl)methyl]naphthalen-1-yl]naphthalen-2-yl]-diphenylphosphane.
What is the Monoisotopic Mass of Phosphine?
The Monoisotopic Mass of Phosphine is 558.211252606.
What is the InChIKey of Phosphine?
The InChIKey of Phosphine is YYQXGGFUDQAZIK-UHFFFAOYSA-N.
How many Covalently-Bonded Unit Counts are present in the Computed Properties of Phosphine?
There is 1 Covalently-Bonded Unit Count present in the Computed Properties of Phosphine.