Phosphetane 1-oxide

Catalog Number	ACM52969229
CAS	52969-22-9
Synonyms	Phosphetan-1-ium 1-oxide
IUPAC Name	phosphetan-1-ium 1-oxide
Molecular Weight	90.06
Molecular Formula	C3H7OP
InChI	LFILZEHCCUHLPK-UHFFFAOYSA-N
InChI Key	InChI=1S/C3H6OP/c4-5-2-1-3-5/h1-3H2/q+1
Purity	98%
Isomeric SMILES	C1C[P+](=O)C1

Q&A

What are some of the other names and synonyms for Phosphetane 1-oxide?

Some other names and synonyms for Phosphetane 1-oxide include NSC617003, 2,2,3,4,4-Pentamethyl-1-phenyl-phosphetane 1-oxide, and NSC234216.

What is the CAS number of Phosphetane 1-oxide?

The CAS number of Phosphetane 1-oxide is 24765-61-5.

What is the Canonical SMILES of Phosphetane 1-oxide?

The Canonical SMILES of Phosphetane 1-oxide is CC1C(P(=O)(C1(C)C)C2=CC=CC=C2)(C)C.

What is the molecular formula of Phosphetane 1-oxide?

The molecular formula of Phosphetane 1-oxide is C14H21OP.

What is the molecular weight of Phosphetane 1-oxide?

The molecular weight of Phosphetane 1-oxide is 236.29g/mol.

How many heavy atoms are present in Phosphetane 1-oxide?

There are 16 heavy atoms present in Phosphetane 1-oxide.

Does Phosphetane 1-oxide contain any hydrogen bond donor?

No, Phosphetane 1-oxide does not contain any hydrogen bond donor.

What is the topological polar surface area of Phosphetane 1-oxide?

The topological polar surface area of Phosphetane 1-oxide is 17.1.

What is the InChIKey of Phosphetane 1-oxide?

The InChIKey of Phosphetane 1-oxide is XUNRSVNAHRPKRH-UHFFFAOYSA-N.