Phenyl dichlorophosphate

Catalog Number	ACM770127
CAS	770-12-7
Structure
Synonyms	Phenyl phosphodichloridate; Phenyl phosphoryl dichloride; Phenyl phosphorodichloridate
IUPAC Name	dichlorophosphoryloxybenzene
Molecular Weight	210.98
Molecular Formula	C6H5Cl2O2P
InChI	TXFOLHZMICYNRM-UHFFFAOYSA-N
InChI Key	InChI=1S/C6H5Cl2O2P/c7-11(8,9)10-6-4-2-1-3-5-6/h1-5H
Boiling Point	241-243 °C (lit.)
Melting Point	-1 °C
Flash Point	>230 °F
Purity	98%
Density	1.412 g/mL at 25 °C(lit.)
Appearance	Liquid
Isomeric SMILES	C1=CC=C(C=C1)OP(=O)(Cl)Cl

Q&A

What is the chemical formula for phenyl dichlorophosphate?

The chemical formula for phenyl dichlorophosphate is C6H5Cl2O2P.

What is the molecular weight of phenyl dichlorophosphate?

The molecular weight of phenyl dichlorophosphate is 210.98g/mol.

What are some synonyms for phenyl dichlorophosphate?

Some synonyms for phenyl dichlorophosphate include Phenoxyphosphoryl dichloride, Phenyl phosphorodichloridate, and Dichlorophenoxyphosphine oxide.

What is the InChIKey for phenyl dichlorophosphate?

The InChIKey for phenyl dichlorophosphate is TXFOLHZMICYNRM-UHFFFAOYSA-N.

How many heavy atoms are present in the structure of phenyl dichlorophosphate?

There are 11 heavy atoms present in the structure of phenyl dichlorophosphate.

How many hydrogen bond acceptor counts are there in phenyl dichlorophosphate?

There are 2 hydrogen bond acceptor counts in phenyl dichlorophosphate.

What is the Canonical SMILES representation of phenyl dichlorophosphate?

The Canonical SMILES representation of phenyl dichlorophosphate is C1=CC=C(C=C1)OP(=O)(Cl)Cl.

What is the UN Number for phenyl dichlorophosphate?

The UN Number for phenyl dichlorophosphate is 3265.

What is the CAS number for phenyl dichlorophosphate?

The CAS number for phenyl dichlorophosphate is 770-12-7.

What is the European Community (EC) Number for phenyl dichlorophosphate?

The European Community (EC) Number for phenyl dichlorophosphate is 212-220-6.