Palladium(II) trimethylacetate

Catalog Number	ACM106224366-2
CAS	106224-36-6
Structure
Synonyms	Palladium pivalate
Molecular Weight	308.67
Molecular Formula	C10H18O4Pd
Canonical SMILES	CC(C)(C)C(=O)[O-].CC(C)(C)C(=O)[O-].[Pd+2]
InChI	InChI=1S/2C5H10O2.Pd/c2*1-5(2,3)4(6)7;/h2*1-3H3,(H,6,7);/q;+2/p-2
InChI Key	PAGZTSLSNQZYEV-UHFFFAOYSA-L
Melting Point	230-232 °C
Purity	99%
Appearance	Yellow brown powder
Complexity	73.1
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	308.02399
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	308.02399
Rotatable Bond Count	0
Topological Polar Surface Area	80.3 Ų

Q&A

What is the molecular weight of Palladium(II) trimethylacetate?

The molecular weight of Palladium(II) trimethylacetate is 309.

What are the product categories that Palladium(II) trimethylacetate belongs to?

Palladium(II) trimethylacetate belongs to metal acetate salt and Pd product categories.

What is the melting point of Palladium(II) trimethylacetate?

The melting point of Palladium(II) trimethylacetate is 230-232 °C.

In what form does Palladium(II) trimethylacetate exist?

Palladium(II) trimethylacetate exists in solid form.

What colors does Palladium(II) trimethylacetate exhibit?

Palladium(II) trimethylacetate is orange in color.

What is the water solubility of Palladium(II) trimethylacetate?

Palladium(II) trimethylacetate is soluble in ethyl acetate, methanol, chloroform, tetrahydrofuran, and 1,4-dioxane, but insoluble in water.

How should Palladium(II) trimethylacetate be stored?

Palladium(II) trimethylacetate should be stored in an inert atmosphere at room temperature.

What are the hazard codes associated with Palladium(II) trimethylacetate?

The hazard code associated with Palladium(II) trimethylacetate is Xi.

What are the safety statements related to Palladium(II) trimethylacetate?

The safety statements for Palladium(II) trimethylacetate are S26.

How is Palladium(II) trimethylacetate used in chemical reactions?

Palladium(II) trimethylacetate is used as a catalyst for various reactions such as aerobic cyclization of acrylic acid with alkenes, benzylation of heterocycles with benzyl chloride, direct arylation reactions, and regioselective oxidative arene cross-coupling.