Nonacarbonyl(triphenylphosphine)dirhenium

Catalog Number	ACM51371621
CAS	51371-62-1
Synonyms	Rhenium,nonacarbonyl(triphenylphosphine)di-, (Re-Re), stereoisomer (9CI)
Molecular Weight	887.8
Molecular Formula	C27H16O9PRe2
Canonical SMILES	[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].C1=CC=C(C=C1)[PH+](C2=CC=CC=C2)C3=CC=CC=C3.[Re].[Re]
InChI	InChI=1S/C18H15P.9CO.2Re/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9*1-2;/h1-15H;/p+1
InChI Key	UZFGPTHCKRELCO-UHFFFAOYSA-O
Purity	98%
Complexity	589
Covalently-Bonded Unit Count	12
Defined Atom Stereocenter Count	0
Exact Mass	886.9619
Heavy Atom Count	39
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	0
Monoisotopic Mass	888.9647
Rotatable Bond Count	3
Topological Polar Surface Area	9 Ų

Q&A

What is the CAS number for nonacarbonyl(triphenylphosphine)dirhenium?

The CAS number for nonacarbonyl(triphenylphosphine)dirhenium is 51371-62-1.

What is the molecular weight of nonacarbonyl(triphenylphosphine)dirhenium?

The molecular weight of nonacarbonyl(triphenylphosphine)dirhenium is 887.8.

What is the product name of nonacarbonyl(triphenylphosphine)dirhenium?

The product name is "Rhenium, nonacarbonyl(triphenylphosphine)di-, (Re-Re), stereoisomer (9CI)."

What are the synonyms for nonacarbonyl(triphenylphosphine)dirhenium?

The synonyms are "Rhenium, nonacarbonyl(triphenylphosphine)di-, (Re-Re), stereoisomer (9CI)" and "Nonacarbonyl(triphenylphosphine)dirhenium."

What is the molecular formula of nonacarbonyl(triphenylphosphine)dirhenium?

The molecular formula is C27H16O9PRe2.

What is the bonding arrangement between the rhenium atoms in nonacarbonyl(triphenylphosphine)dirhenium?

The bonding arrangement is described as nonacarbonyl, which means there are nine carbonyl groups bonded to the rhenium atoms.

How does the presence of triphenylphosphine affect the properties of nonacarbonyl(triphenylphosphine)dirhenium?

Triphenylphosphine likely serves as a coordinating ligand to the rhenium atoms, influencing the overall reactivity and stability of the compound.