N4,N4-Dimethylhexane-1,4-diamine

Catalog Number	ACM362047152
CAS	362047-15-2
Structure
Synonyms	4-N,4-N-Dimethylhexane-1,4-Diamine
IUPAC Name	4-N,4-N-dimethylhexane-1,4-diamine
Molecular Weight	144.26
Molecular Formula	C8H20N2
InChI	KLJUVZPCSXYTQK-UHFFFAOYSA-N
InChI Key	InChI=1S/C8H20N2/c1-4-8(10(2)3)6-5-7-9/h8H,4-7,9H2,1-3H3
Purity	98%
Isomeric SMILES	CCC(CCCN)N(C)C

Q&A

What is the CAS number of N4,N4-Dimethylhexane-1,4-diamine?

CAS: 362047-15-2

What is the molecular weight of N4,N4-Dimethylhexane-1,4-diamine?

MW: 144.2578

What product categories does N4,N4-Dimethylhexane-1,4-diamine fall under?

Product Categories: AMINETERTIARY

What is the product name of N4,N4-Dimethylhexane-1,4-diamine under the 9CI nomenclature?

Product Name: 1,4-Hexanediamine,N4,N4-dimethyl-(9CI)

What are the synonyms for N4,N4-Dimethylhexane-1,4-diamine?

Synonyms: 1,4-Hexanediamine,N4,N4-dimethyl-(9CI); N4,N4-Dimethylhexane-1,4-diamine

What is the molecular formula of N4,N4-Dimethylhexane-1,4-diamine?

MF: C8H20N2

What is the chemical structure of N4,N4-Dimethylhexane-1,4-diamine?

The chemical structure is C8H20N2 with methyl groups attached to the nitrogen atoms in the 4-position.

What is the role of N4,N4-Dimethylhexane-1,4-diamine in chemical reactions?

N4,N4-Dimethylhexane-1,4-diamine can act as a tertiary amine in various reactions.

How does the molecular weight of N4,N4-Dimethylhexane-1,4-diamine compare to common organic compounds?

The molecular weight of N4,N4-Dimethylhexane-1,4-diamine, 144.2578, is relatively low compared to many common organic compounds.

In what industries or applications is N4,N4-Dimethylhexane-1,4-diamine commonly used?

N4,N4-Dimethylhexane-1,4-diamine may be used in industries or applications that require a tertiary amine functionality, such as in organic synthesis or as a catalyst.