ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N3-Ethyl-N3-methylbutane-1,3-diamine

Catalog Number ACM1033693036
CAS 1033693-03-6
Synonyms (3-Amino-1-methylpropyl)ethyl(methyl)amine; 3-N-Ethyl-3-N-Methylbutane-1,3-Diamine
IUPAC Name 3-N-ethyl-3-N-methylbutane-1,3-diamine
Molecular Weight 130.23
Molecular Formula C7H18N2
InChI UVQPZTDUOSENTP-UHFFFAOYSA-N
InChI Key InChI=1S/C7H18N2/c1-4-9(3)7(2)5-6-8/h7H,4-6,8H2,1-3H3
Purity 98%
Isomeric SMILES CCN(C)C(C)CCN
Q&A

What is the CAS number for N3-Ethyl-N3-methylbutane-1,3-diamine?

The CAS number for N3-Ethyl-N3-methylbutane-1,3-diamine is 1033693-03-6.

What is the molecular weight of N3-Ethyl-N3-methylbutane-1,3-diamine?

The molecular weight of N3-Ethyl-N3-methylbutane-1,3-diamine is 130.23.

What is another name for N3-Ethyl-N3-methylbutane-1,3-diamine?

Another name for N3-Ethyl-N3-methylbutane-1,3-diamine is N-(3-amino-1-methylpropyl)-N-ethyl-N-methylamine.

What are some synonyms for N3-Ethyl-N3-methylbutane-1,3-diamine?

Some synonyms for N3-Ethyl-N3-methylbutane-1,3-diamine are (3-Amino-1-methylpropyl)ethyl(methyl)amine and 1,3-Butanediamine.

What is the molecular formula of N3-Ethyl-N3-methylbutane-1,3-diamine?

The molecular formula of N3-Ethyl-N3-methylbutane-1,3-diamine is C7H18N2.

What are the hazard codes associated with N3-Ethyl-N3-methylbutane-1,3-diamine?

The hazard codes associated with N3-Ethyl-N3-methylbutane-1,3-diamine are Xn.

What hazard class does N3-Ethyl-N3-methylbutane-1,3-diamine belong to?

N3-Ethyl-N3-methylbutane-1,3-diamine belongs to the irritant hazard class.

What risk statements are associated with N3-Ethyl-N3-methylbutane-1,3-diamine?

The risk statement associated with N3-Ethyl-N3-methylbutane-1,3-diamine is 22.

What is the chemical formula for N3-Ethyl-N3-methylbutane-1,3-diamine?

The chemical formula for N3-Ethyl-N3-methylbutane-1,3-diamine is C7H18N2.

Please kindly note that our products and services are for research use only.