ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine

Catalog Number ACM858523656
CAS 858523-65-6
Synonyms [2-(Methylamino)-2-Phenylethyl]Dimethylamine
IUPAC Name N,N',N'-trimethyl-1-phenylethane-1,2-diamine
Molecular Weight 178.27
Molecular Formula C11H18N2
InChI MKQJYCPIRLKEPN-UHFFFAOYSA-N
InChI Key InChI=1S/C11H18N2/c1-12-11(9-13(2)3)10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3
Purity 97%
Isomeric SMILES CNC(CN(C)C)C1=CC=CC=C1
Q&A

What is the chemical structure of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

The chemical structure of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine is C11H18N2.

What is the molecular weight of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

The molecular weight of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine is 178.27 g/mol.

What are the synonyms for N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

The synonyms for N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine are N1,N2,N2-trimethyl-1-phenyl-1,2-Ethanediamine and N1,N2,N2-TRIMETHYL-1-PHENYLETHANE-1,2-DIAMINE.

What is the boiling point of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

The boiling point of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine is predicted to be 252.3±28.0 °C.

What is the predicted pKa value of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

The predicted pKa value of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine is 9.35±0.20.

What is the predicted density of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

The predicted density of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine is 0.945±0.06 g/cm3.

Is N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine considered a volatile compound?

Yes, N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine is considered volatile based on its predicted boiling point.

What functional groups are present in the chemical structure of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

The functional groups present in the chemical structure of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine are amine groups and a phenyl group.

How many carbon atoms are present in the chemical structure of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

The chemical structure of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine contains 11 carbon atoms.

What are some potential uses of N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine?

N1,N2,N2-Trimethyl-1-phenylethane-1,2-diamine can potentially be used as a reagent in chemical synthesis or as an intermediate in the production of other compounds.

Please kindly note that our products and services are for research use only.