ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine

Catalog Number ACM105931-1
CAS 105-93-1
Structure {[CurrentData.Name]}
Synonyms 1,4,7-Triethyldiethylenetriamine
IUPAC Name N,N'-diethyl-N'-[2-(ethylamino)ethyl]ethane-1,2-diamine
Molecular Weight 187.33
Molecular Formula C10H25N3
InChI ICDOTLXZHXEZNU-UHFFFAOYSA-N
InChI Key InChI=1S/C10H25N3/c1-4-11-7-9-13(6-3)10-8-12-5-2/h11-12H,4-10H2,1-3H3
Boiling Point 66-67 °C
Purity 98%
Isomeric SMILES CCNCCN(CC)CCNCC
Q&A

What is the molecular weight of 1,4,7-TRIETHYLDIETHYLENETRIAMINE?

The molecular weight of 1,4,7-TRIETHYLDIETHYLENETRIAMINE is 187.33.

What are some synonyms for N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine?

Some synonyms include N-ethylbis(2-ethylaminoethyl)amine, 6-Ethyl-3,6,9-triazaundecane, and ethyl-bis[2-(ethylamino)ethyl]amine.

What is the molecular formula of N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine?

The molecular formula is C10H25N3.

What is the EINECS number for N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine?

The EINECS number is 203-346-2.

What is the boiling point of N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine?

The boiling point is 66-67°C.

What is the predicted pKa value of N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine?

The predicted pKa value is 10.43±0.19.

What is the predicted density of N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine?

The predicted density is 0.857±0.06 g/cm3.

What is the EPA Substance Registry System number for N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine?

The EPA Substance Registry System number is 105-93-1.

What is the IUPAC name for N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine?

The IUPAC name is N,N'-Diethyl-N-[2-(ethylamino)ethyl]-1,2-ethanediamine.

What are the different ways N1,N2-Diethyl-N1-(2-(ethylamino)ethyl)ethane-1,2-diamine can be referred to?

It can also be referred to as N,N,N-triethyldiethylenetriamine and 2,2'-(Ethylimino)bis(N-ethylethanamine).

Please kindly note that our products and services are for research use only.