ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine

Catalog Number ACM136469846
CAS 136469-84-6
Synonyms [2-(Dimethylamino)Ethyl](Pyridin-4-Ylmethyl)Amine
IUPAC Name N',N'-dimethyl-N-(pyridin-4-ylmethyl)ethane-1,2-diamine
Molecular Weight 179.26
Molecular Formula C10H17N3
InChI QQSDZNWIOXPTLT-UHFFFAOYSA-N
InChI Key InChI=1S/C10H17N3/c1-13(2)8-7-12-9-10-3-5-11-6-4-10/h3-6,12H,7-9H2,1-2H3
Purity 98%
Isomeric SMILES CN(C)CCNCC1=CC=NC=C1
Q&A

What is the molecular weight of N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine?

The molecular weight is 179.26.

What is the chemical formula for N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine?

The chemical formula is C10H17N3.

What are some synonyms for N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine?

Some synonyms include N,N-DIMETHYL-N'-PYRIDIN-4-YLMETHYL-ETHANE-1,2-DIAMINE and 1,2-Ethanediamine, N1,N1-dimethyl-N2-(4-pyridinylmethyl)-.

What are the hazard codes associated with N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine?

The hazard codes are Xi and Xn.

What is the hazard class of N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine?

The hazard class is IRRITANT.

What are the risk statements associated with N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine?

The risk statement is 22.

Is N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine considered a hazardous chemical?

Yes, it is considered a hazardous chemical with irritant properties.

What is the IUPAC name for N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine?

The IUPAC name is 2-(dimethylamino)ethyl](pyridin-4-ylmethyl)amine.

What type of compound is N1,N1-Dimethyl-N2-(pyridin-4-ylmethyl)ethane-1,2-diamine?

It is a diamine compound.

Please kindly note that our products and services are for research use only.